About 2-methylspiro[4,5-dihydrocyclopenta[c]pyrazole-6,1'-cyclohexane]-3-carboxylic acid
2-methylspiro[4,5-dihydrocyclopenta[c]pyrazole-6,1'-cyclohexane]-3-carboxylic acid (PubChem CID 58425465) has the molecular formula C13H18N2O2
and a molecular weight of 234.30 g/mol. Its IUPAC name is 2-methylspiro[4,5-dihydrocyclopenta[c]pyrazole-6,1'-cyclohexane]-3-carboxylic acid.
Molecular Properties
| Compound Name | 2-methylspiro[4,5-dihydrocyclopenta[c]pyrazole-6,1'-cyclohexane]-3-carboxylic acid |
| PubChem CID | 58425465 |
| Molecular Formula | C13H18N2O2 |
| Molecular Weight | 234.30 g/mol |
| Exact Mass | 234.14 |
| IUPAC Name | 2-methylspiro[4,5-dihydrocyclopenta[c]pyrazole-6,1'-cyclohexane]-3-carboxylic acid |
| SMILES | Cn1nc2c(c1C(=O)O)CCC21CCCCC1 |
| InChI | InChI=1S/C13H18N2O2/c1-15-10(12(16)17)9-5-8-13(11(9)14-15)6-3-2-4-7-13/h2-8H2,1H3,(H,16,17) |
| InChIKey | FKFGKZBWTABIKD-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 234.30 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-methylspiro[4,5-dihydrocyclopenta[c]pyrazole-6,1'-cyclohexane]-3-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methylspiro[4,5-dihydrocyclopenta[c]pyrazole-6,1'-cyclohexane]-3-carboxylic acid?
The IUPAC name of 2-methylspiro[4,5-dihydrocyclopenta[c]pyrazole-6,1'-cyclohexane]-3-carboxylic acid (CID 58425465) is 2-methylspiro[4,5-dihydrocyclopenta[c]pyrazole-6,1'-cyclohexane]-3-carboxylic acid.
What is the SMILES notation for 2-methylspiro[4,5-dihydrocyclopenta[c]pyrazole-6,1'-cyclohexane]-3-carboxylic acid?
The canonical SMILES for 2-methylspiro[4,5-dihydrocyclopenta[c]pyrazole-6,1'-cyclohexane]-3-carboxylic acid is Cn1nc2c(c1C(=O)O)CCC21CCCCC1.
What is the InChIKey of 2-methylspiro[4,5-dihydrocyclopenta[c]pyrazole-6,1'-cyclohexane]-3-carboxylic acid?
The InChIKey is FKFGKZBWTABIKD-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H18N2O2/c1-15-10(12(16)17)9-5-8-13(11(9)14-15)6-3-2-4-7-13/h2-8H2,1H3,(H,16,17).
What are the key properties of 2-methylspiro[4,5-dihydrocyclopenta[c]pyrazole-6,1'-cyclohexane]-3-carboxylic acid?
2-methylspiro[4,5-dihydrocyclopenta[c]pyrazole-6,1'-cyclohexane]-3-carboxylic acid has a molecular weight of 234.30 g/mol, XLogP of 2.27, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylspiro[4,5-dihydrocyclopenta[c]pyrazole-6,1'-cyclohexane]-3-carboxylic acid is sourced from PubChem (CID 58425465), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).