C35H36N6O5 — CID 58425553
tert-butyl 3-[6-(1,3-dioxoisoindol-2-yl)hex-2-ynoyl]-5-[1-(2-pyrrolidin-1-ylethyl)pyrazol-4-yl]pyrrolo[2,3-b]pyridine-1-carboxylate (PubChem CID 58425553) has the molecular formula C35H36N6O5 and a molecular weight of 620.71 g/mol. Its IUPAC name is tert-butyl 3-[6-(1,3-dioxoisoindol-2-yl)hex-2-ynoyl]-5-[1-(2-pyrrolidin-1-ylethyl)pyrazol-4-yl]pyrrolo[2,3-b]pyridine-1-carboxylate.
| Compound Name | tert-butyl 3-[6-(1,3-dioxoisoindol-2-yl)hex-2-ynoyl]-5-[1-(2-pyrrolidin-1-ylethyl)pyrazol-4-yl]pyrrolo[2,3-b]pyridine-1-carboxylate |
|---|---|
| PubChem CID | 58425553 |
| Molecular Formula | C35H36N6O5 |
| Molecular Weight | 620.71 g/mol |
| Exact Mass | 620.27 |
| IUPAC Name | tert-butyl 3-[6-(1,3-dioxoisoindol-2-yl)hex-2-ynoyl]-5-[1-(2-pyrrolidin-1-ylethyl)pyrazol-4-yl]pyrrolo[2,3-b]pyridine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)n1cc(C(=O)C#CCCCN2C(=O)c3ccccc3C2=O)c2cc(-c3cnn(CCN4CCCC4)c3)cnc21 |
| InChI | InChI=1S/C35H36N6O5/c1-35(2,3)46-34(45)41-23-29(30(42)13-5-4-8-16-40-32(43)26-11-6-7-12-27(26)33(40)44)28-19-24(20-36-31(28)41)25-21-37-39(22-25)18-17-38-14-9-10-15-38/h6-7,11-12,19-23H,4,8-10,14-18H2,1-3H3 |
| InChIKey | CISGJLUGGVXXTC-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 119.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 620.71 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_2', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|