C13H15F5N4O — CID 58425692
4-amino-5,5-dimethyl-2-(4,4,5,5,5-pentafluoropentyl)-7H-pyrrolo[2,3-d]pyrimidin-6-one (PubChem CID 58425692) has the molecular formula C13H15F5N4O and a molecular weight of 338.28 g/mol. Its IUPAC name is 4-amino-5,5-dimethyl-2-(4,4,5,5,5-pentafluoropentyl)-7H-pyrrolo[2,3-d]pyrimidin-6-one.
| Compound Name | 4-amino-5,5-dimethyl-2-(4,4,5,5,5-pentafluoropentyl)-7H-pyrrolo[2,3-d]pyrimidin-6-one |
|---|---|
| PubChem CID | 58425692 |
| Molecular Formula | C13H15F5N4O |
| Molecular Weight | 338.28 g/mol |
| Exact Mass | 338.12 |
| IUPAC Name | 4-amino-5,5-dimethyl-2-(4,4,5,5,5-pentafluoropentyl)-7H-pyrrolo[2,3-d]pyrimidin-6-one |
| SMILES | CC1(C)C(=O)Nc2nc(CCCC(F)(F)C(F)(F)F)nc(N)c21 |
| InChI | InChI=1S/C13H15F5N4O/c1-11(2)7-8(19)20-6(21-9(7)22-10(11)23)4-3-5-12(14,15)13(16,17)18/h3-5H2,1-2H3,(H3,19,20,21,22,23) |
| InChIKey | YAQJSQANPDWHCJ-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 80.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.28 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|