C22H36N2O4 — CID 58425951
N-[7-[(2-cyclohexyl-2-oxoethyl)amino]-2,7-dioxoheptyl]cyclohexanecarboxamide (PubChem CID 58425951) has the molecular formula C22H36N2O4 and a molecular weight of 392.54 g/mol. Its IUPAC name is N-[7-[(2-cyclohexyl-2-oxoethyl)amino]-2,7-dioxoheptyl]cyclohexanecarboxamide.
| Compound Name | N-[7-[(2-cyclohexyl-2-oxoethyl)amino]-2,7-dioxoheptyl]cyclohexanecarboxamide |
|---|---|
| PubChem CID | 58425951 |
| Molecular Formula | C22H36N2O4 |
| Molecular Weight | 392.54 g/mol |
| Exact Mass | 392.27 |
| IUPAC Name | N-[7-[(2-cyclohexyl-2-oxoethyl)amino]-2,7-dioxoheptyl]cyclohexanecarboxamide |
| SMILES | O=C(CCCCC(=O)NCC(=O)C1CCCCC1)CNC(=O)C1CCCCC1 |
| InChI | InChI=1S/C22H36N2O4/c25-19(15-24-22(28)18-11-5-2-6-12-18)13-7-8-14-21(27)23-16-20(26)17-9-3-1-4-10-17/h17-18H,1-16H2,(H,23,27)(H,24,28) |
| InChIKey | KEFZEVJKJALQAH-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 92.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.54 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|