C27H27N3O2 — CID 58425971
N-[(E)-[4-[[2-(3,4-dimethylphenyl)-2-oxoethyl]iminomethyl]phenyl]methylideneamino]-3,4-dimethylbenzamide (PubChem CID 58425971) has the molecular formula C27H27N3O2 and a molecular weight of 425.53 g/mol. Its IUPAC name is N-[(E)-[4-[[2-(3,4-dimethylphenyl)-2-oxoethyl]iminomethyl]phenyl]methylideneamino]-3,4-dimethylbenzamide.
| Compound Name | N-[(E)-[4-[[2-(3,4-dimethylphenyl)-2-oxoethyl]iminomethyl]phenyl]methylideneamino]-3,4-dimethylbenzamide |
|---|---|
| PubChem CID | 58425971 |
| Molecular Formula | C27H27N3O2 |
| Molecular Weight | 425.53 g/mol |
| Exact Mass | 425.21 |
| IUPAC Name | N-[(E)-[4-[[2-(3,4-dimethylphenyl)-2-oxoethyl]iminomethyl]phenyl]methylideneamino]-3,4-dimethylbenzamide |
| SMILES | Cc1ccc(C(=O)C/N=C/c2ccc(/C=N/NC(=O)c3ccc(C)c(C)c3)cc2)cc1C |
| InChI | InChI=1S/C27H27N3O2/c1-18-5-11-24(13-20(18)3)26(31)17-28-15-22-7-9-23(10-8-22)16-29-30-27(32)25-12-6-19(2)21(4)14-25/h5-16H,17H2,1-4H3,(H,30,32)/b28-15+,29-16+ |
| InChIKey | BXLWICLSXGOYGU-QSXCDPBRSA-N |
| XLogP | 4.99 |
| TPSA | 70.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.53 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|