C18H21F13O4 — CID 58426019
1-O-methyl 5-O-(3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctyl) 2-ethyl-2,4-dimethylpentanedioate (PubChem CID 58426019) has the molecular formula C18H21F13O4 and a molecular weight of 548.34 g/mol. Its IUPAC name is 1-O-methyl 5-O-(3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctyl) 2-ethyl-2,4-dimethylpentanedioate.
| Compound Name | 1-O-methyl 5-O-(3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctyl) 2-ethyl-2,4-dimethylpentanedioate |
|---|---|
| PubChem CID | 58426019 |
| Molecular Formula | C18H21F13O4 |
| Molecular Weight | 548.34 g/mol |
| Exact Mass | 548.12 |
| IUPAC Name | 1-O-methyl 5-O-(3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctyl) 2-ethyl-2,4-dimethylpentanedioate |
| SMILES | CCC(C)(CC(C)C(=O)OCCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)C(=O)OC |
| InChI | InChI=1S/C18H21F13O4/c1-5-12(3,11(33)34-4)8-9(2)10(32)35-7-6-13(19,20)14(21,22)15(23,24)16(25,26)17(27,28)18(29,30)31/h9H,5-8H2,1-4H3 |
| InChIKey | LLOZGKSTEOPLKI-UHFFFAOYSA-N |
| XLogP | 6.27 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.34 |
| LogP ≤ 5 | 6.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|