C9H13F7OY-2 — CID 58426034
fluoromethane;1,1,2,4,4,5-hexafluoro-1-methoxy-2-methylhexane;yttrium (PubChem CID 58426034) has the molecular formula C9H13F7OY-2 and a molecular weight of 359.09 g/mol. Its IUPAC name is fluoromethane;1,1,2,4,4,5-hexafluoro-1-methoxy-2-methylhexane;yttrium.
| Compound Name | fluoromethane;1,1,2,4,4,5-hexafluoro-1-methoxy-2-methylhexane;yttrium |
|---|---|
| PubChem CID | 58426034 |
| Molecular Formula | C9H13F7OY-2 |
| Molecular Weight | 359.09 g/mol |
| Exact Mass | 358.99 |
| IUPAC Name | fluoromethane;1,1,2,4,4,5-hexafluoro-1-methoxy-2-methylhexane;yttrium |
| SMILES | COC(F)(F)C(C)(F)CC(F)(F)[C-](C)F.[CH2-]F.[Y] |
| InChI | InChI=1S/C8H11F6O.CH2F.Y/c1-5(9)7(11,12)4-6(2,10)8(13,14)15-3;1-2;/h4H2,1-3H3;1H2;/q2*-1; |
| InChIKey | GJOSHUONSAOWIR-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.09 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|