C10H15F7OY-2 — CID 58426037
ethane;1,1,2,4,4,5,6-heptafluoro-1-methoxy-2-methylhexane;yttrium (PubChem CID 58426037) has the molecular formula C10H15F7OY-2 and a molecular weight of 373.12 g/mol. Its IUPAC name is ethane;1,1,2,4,4,5,6-heptafluoro-1-methoxy-2-methylhexane;yttrium.
| Compound Name | ethane;1,1,2,4,4,5,6-heptafluoro-1-methoxy-2-methylhexane;yttrium |
|---|---|
| PubChem CID | 58426037 |
| Molecular Formula | C10H15F7OY-2 |
| Molecular Weight | 373.12 g/mol |
| Exact Mass | 373.01 |
| IUPAC Name | ethane;1,1,2,4,4,5,6-heptafluoro-1-methoxy-2-methylhexane;yttrium |
| SMILES | COC(F)(F)C(C)(F)CC(F)(F)[C-](F)CF.[CH2-]C.[Y] |
| InChI | InChI=1S/C8H10F7O.C2H5.Y/c1-6(11,8(14,15)16-2)4-7(12,13)5(10)3-9;1-2;/h3-4H2,1-2H3;1H2,2H3;/q2*-1; |
| InChIKey | SQYVNQZUJNPNTK-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.12 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|