C10H9NO3 — CID 58426066
2,3,4-trimethylfuro[3,4-b]pyridine-5,7-dione (PubChem CID 58426066) has the molecular formula C10H9NO3 and a molecular weight of 191.19 g/mol. Its IUPAC name is 2,3,4-trimethylfuro[3,4-b]pyridine-5,7-dione.
| Compound Name | 2,3,4-trimethylfuro[3,4-b]pyridine-5,7-dione |
|---|---|
| PubChem CID | 58426066 |
| Molecular Formula | C10H9NO3 |
| Molecular Weight | 191.19 g/mol |
| Exact Mass | 191.06 |
| IUPAC Name | 2,3,4-trimethylfuro[3,4-b]pyridine-5,7-dione |
| SMILES | Cc1nc2c(c(C)c1C)C(=O)OC2=O |
| InChI | InChI=1S/C10H9NO3/c1-4-5(2)7-8(11-6(4)3)10(13)14-9(7)12/h1-3H3 |
| InChIKey | DWUJWDDKDCHBFI-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 56.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.19 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|