C17H30O — CID 58426114
(3aR,5aS,9aR,9bR)-3a,5a,6,6,9a-pentamethyl-1,2,4,5,7,8,9,9b-octahydrobenzo[e][1]benzofuran (PubChem CID 58426114) has the molecular formula C17H30O and a molecular weight of 250.43 g/mol. Its IUPAC name is (3aR,5aS,9aR,9bR)-3a,5a,6,6,9a-pentamethyl-1,2,4,5,7,8,9,9b-octahydrobenzo[e][1]benzofuran.
| Compound Name | (3aR,5aS,9aR,9bR)-3a,5a,6,6,9a-pentamethyl-1,2,4,5,7,8,9,9b-octahydrobenzo[e][1]benzofuran |
|---|---|
| PubChem CID | 58426114 |
| Molecular Formula | C17H30O |
| Molecular Weight | 250.43 g/mol |
| Exact Mass | 250.23 |
| IUPAC Name | (3aR,5aS,9aR,9bR)-3a,5a,6,6,9a-pentamethyl-1,2,4,5,7,8,9,9b-octahydrobenzo[e][1]benzofuran |
| SMILES | CC1(C)CCC[C@]2(C)[C@H]3CCO[C@]3(C)CC[C@@]12C |
| InChI | InChI=1S/C17H30O/c1-14(2)8-6-9-15(3)13-7-12-18-16(13,4)10-11-17(14,15)5/h13H,6-12H2,1-5H3/t13-,15-,16-,17+/m1/s1 |
| InChIKey | PDAZXMWFMCUCQC-DZUCGIPZSA-N |
| XLogP | 4.80 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.43 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |