C15H19N3O5 — CID 58426290
5-[(E)-3-[bis(2-oxopropyl)amino]prop-2-enylidene]-1,3-dimethyl-1,3-diazinane-2,4,6-trione (PubChem CID 58426290) has the molecular formula C15H19N3O5 and a molecular weight of 321.33 g/mol. Its IUPAC name is 5-[(E)-3-[bis(2-oxopropyl)amino]prop-2-enylidene]-1,3-dimethyl-1,3-diazinane-2,4,6-trione.
| Compound Name | 5-[(E)-3-[bis(2-oxopropyl)amino]prop-2-enylidene]-1,3-dimethyl-1,3-diazinane-2,4,6-trione |
|---|---|
| PubChem CID | 58426290 |
| Molecular Formula | C15H19N3O5 |
| Molecular Weight | 321.33 g/mol |
| Exact Mass | 321.13 |
| IUPAC Name | 5-[(E)-3-[bis(2-oxopropyl)amino]prop-2-enylidene]-1,3-dimethyl-1,3-diazinane-2,4,6-trione |
| SMILES | CC(=O)CN(/C=C/C=C1C(=O)N(C)C(=O)N(C)C1=O)CC(C)=O |
| InChI | InChI=1S/C15H19N3O5/c1-10(19)8-18(9-11(2)20)7-5-6-12-13(21)16(3)15(23)17(4)14(12)22/h5-7H,8-9H2,1-4H3/b7-5+ |
| InChIKey | VMMDLLUOIAYRPL-FNORWQNLSA-N |
| XLogP | -0.04 |
| TPSA | 95.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.33 |
| LogP ≤ 5 | -0.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|