C33H27F3IrN7- — CID 58426466
3-(9,9-dimethyl-3H-fluoren-3-id-2-yl)-5-methyl-4-phenyl-1,2,4-triazole;iridium;1-methyl-2-[5-(trifluoromethyl)-1,4-diaza-2-azanidacyclopenta-3,5-dien-3-yl]pyridin-1-ium (PubChem CID 58426466) has the molecular formula C33H27F3IrN7- and a molecular weight of 770.84 g/mol. Its IUPAC name is 3-(9,9-dimethyl-3H-fluoren-3-id-2-yl)-5-methyl-4-phenyl-1,2,4-triazole;iridium;1-methyl-2-[5-(trifluoromethyl)-1,4-diaza-2-azanidacyclopenta-3,5-dien-3-yl]pyridin-1-ium.
| Compound Name | 3-(9,9-dimethyl-3H-fluoren-3-id-2-yl)-5-methyl-4-phenyl-1,2,4-triazole;iridium;1-methyl-2-[5-(trifluoromethyl)-1,4-diaza-2-azanidacyclopenta-3,5-dien-3-yl]pyridin-1-ium |
|---|---|
| PubChem CID | 58426466 |
| Molecular Formula | C33H27F3IrN7- |
| Molecular Weight | 770.84 g/mol |
| Exact Mass | 771.19 |
| IUPAC Name | 3-(9,9-dimethyl-3H-fluoren-3-id-2-yl)-5-methyl-4-phenyl-1,2,4-triazole;iridium;1-methyl-2-[5-(trifluoromethyl)-1,4-diaza-2-azanidacyclopenta-3,5-dien-3-yl]pyridin-1-ium |
| SMILES | C[n+]1ccccc1-c1nc(C(F)(F)F)n[n-]1.Cc1nnc(-c2[c-]cc3c(c2)C(C)(C)c2ccccc2-3)n1-c1ccccc1.[Ir] |
| InChI | InChI=1S/C24H20N3.C9H7F3N4.Ir/c1-16-25-26-23(27(16)18-9-5-4-6-10-18)17-13-14-20-19-11-7-8-12-21(19)24(2,3)22(20)15-17;1-16-5-3-2-4-6(16)7-13-8(15-14-7)9(10,11)12;/h4-12,14-15H,1-3H3;2-5H,1H3;/q-1;; |
| InChIKey | QZKHHQLETMFNPS-UHFFFAOYSA-N |
| XLogP | 6.29 |
| TPSA | 74.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 770.84 |
| LogP ≤ 5 | 6.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|