C27H22F5IrN7-2 — CID 58426468
3-(1,1-difluoropentyl)-4-phenyl-5-phenyl-1,2,4-triazole;iridium;2-[5-(trifluoromethyl)-1,4-diaza-2-azanidacyclopenta-3,5-dien-3-yl]pyridine (PubChem CID 58426468) has the molecular formula C27H22F5IrN7-2 and a molecular weight of 731.73 g/mol. Its IUPAC name is 3-(1,1-difluoropentyl)-4-phenyl-5-phenyl-1,2,4-triazole;iridium;2-[5-(trifluoromethyl)-1,4-diaza-2-azanidacyclopenta-3,5-dien-3-yl]pyridine.
| Compound Name | 3-(1,1-difluoropentyl)-4-phenyl-5-phenyl-1,2,4-triazole;iridium;2-[5-(trifluoromethyl)-1,4-diaza-2-azanidacyclopenta-3,5-dien-3-yl]pyridine |
|---|---|
| PubChem CID | 58426468 |
| Molecular Formula | C27H22F5IrN7-2 |
| Molecular Weight | 731.73 g/mol |
| Exact Mass | 732.15 |
| IUPAC Name | 3-(1,1-difluoropentyl)-4-phenyl-5-phenyl-1,2,4-triazole;iridium;2-[5-(trifluoromethyl)-1,4-diaza-2-azanidacyclopenta-3,5-dien-3-yl]pyridine |
| SMILES | CCCCC(F)(F)c1nnc(-c2[c-]cccc2)n1-c1ccccc1.FC(F)(F)c1n[n-]c(-c2ccccn2)n1.[Ir] |
| InChI | InChI=1S/C19H18F2N3.C8H4F3N4.Ir/c1-2-3-14-19(20,21)18-23-22-17(15-10-6-4-7-11-15)24(18)16-12-8-5-9-13-16;9-8(10,11)7-13-6(14-15-7)5-3-1-2-4-12-5;/h4-10,12-13H,2-3,14H2,1H3;1-4H;/q2*-1; |
| InChIKey | DCPYHMADLLPKHI-UHFFFAOYSA-N |
| XLogP | 6.53 |
| TPSA | 83.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 731.73 |
| LogP ≤ 5 | 6.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|