C27H23FN2O5 — CID 58426759
(3R)-11-acetyl-6-[(4-fluorophenyl)methyl]-3-(hydroxymethyl)-10-phenylmethoxy-4-oxa-1,8-diazatricyclo[7.3.1.05,13]trideca-5(13),6,8,10-tetraen-12-one (PubChem CID 58426759) has the molecular formula C27H23FN2O5 and a molecular weight of 474.49 g/mol. Its IUPAC name is (3R)-11-acetyl-6-[(4-fluorophenyl)methyl]-3-(hydroxymethyl)-10-phenylmethoxy-4-oxa-1,8-diazatricyclo[7.3.1.05,13]trideca-5(13),6,8,10-tetraen-12-one.
| Compound Name | (3R)-11-acetyl-6-[(4-fluorophenyl)methyl]-3-(hydroxymethyl)-10-phenylmethoxy-4-oxa-1,8-diazatricyclo[7.3.1.05,13]trideca-5(13),6,8,10-tetraen-12-one |
|---|---|
| PubChem CID | 58426759 |
| Molecular Formula | C27H23FN2O5 |
| Molecular Weight | 474.49 g/mol |
| Exact Mass | 474.16 |
| IUPAC Name | (3R)-11-acetyl-6-[(4-fluorophenyl)methyl]-3-(hydroxymethyl)-10-phenylmethoxy-4-oxa-1,8-diazatricyclo[7.3.1.05,13]trideca-5(13),6,8,10-tetraen-12-one |
| SMILES | CC(=O)c1c(OCc2ccccc2)c2ncc(Cc3ccc(F)cc3)c3c2n(c1=O)C[C@H](CO)O3 |
| InChI | InChI=1S/C27H23FN2O5/c1-16(32)22-26(34-15-18-5-3-2-4-6-18)23-24-25(35-21(14-31)13-30(24)27(22)33)19(12-29-23)11-17-7-9-20(28)10-8-17/h2-10,12,21,31H,11,13-15H2,1H3/t21-/m1/s1 |
| InChIKey | KPUZFDQZHMZGDF-OAQYLSRUSA-N |
| XLogP | 3.66 |
| TPSA | 90.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.49 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |