C27H21FN2O6 — CID 58426767
(3R)-11-acetyl-6-[(4-fluorophenyl)methyl]-12-oxo-10-phenylmethoxy-4-oxa-1,8-diazatricyclo[7.3.1.05,13]trideca-5(13),6,8,10-tetraene-3-carboxylic acid (PubChem CID 58426767) has the molecular formula C27H21FN2O6 and a molecular weight of 488.47 g/mol. Its IUPAC name is (3R)-11-acetyl-6-[(4-fluorophenyl)methyl]-12-oxo-10-phenylmethoxy-4-oxa-1,8-diazatricyclo[7.3.1.05,13]trideca-5(13),6,8,10-tetraene-3-carboxylic acid.
| Compound Name | (3R)-11-acetyl-6-[(4-fluorophenyl)methyl]-12-oxo-10-phenylmethoxy-4-oxa-1,8-diazatricyclo[7.3.1.05,13]trideca-5(13),6,8,10-tetraene-3-carboxylic acid |
|---|---|
| PubChem CID | 58426767 |
| Molecular Formula | C27H21FN2O6 |
| Molecular Weight | 488.47 g/mol |
| Exact Mass | 488.14 |
| IUPAC Name | (3R)-11-acetyl-6-[(4-fluorophenyl)methyl]-12-oxo-10-phenylmethoxy-4-oxa-1,8-diazatricyclo[7.3.1.05,13]trideca-5(13),6,8,10-tetraene-3-carboxylic acid |
| SMILES | CC(=O)c1c(OCc2ccccc2)c2ncc(Cc3ccc(F)cc3)c3c2n(c1=O)C[C@H](C(=O)O)O3 |
| InChI | InChI=1S/C27H21FN2O6/c1-15(31)21-25(35-14-17-5-3-2-4-6-17)22-23-24(36-20(27(33)34)13-30(23)26(21)32)18(12-29-22)11-16-7-9-19(28)10-8-16/h2-10,12,20H,11,13-14H2,1H3,(H,33,34)/t20-/m1/s1 |
| InChIKey | WKYVAHLRLRXRPK-HXUWFJFHSA-N |
| XLogP | 3.75 |
| TPSA | 107.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.47 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |