C22H15FN2O3S — CID 58426832
9-cyclopropyl-6-fluoro-7-[2-(4-methoxyphenyl)ethynyl]-[1,2]thiazolo[5,4-b]quinoline-3,4-dione (PubChem CID 58426832) has the molecular formula C22H15FN2O3S and a molecular weight of 406.44 g/mol. Its IUPAC name is 9-cyclopropyl-6-fluoro-7-[2-(4-methoxyphenyl)ethynyl]-[1,2]thiazolo[5,4-b]quinoline-3,4-dione.
| Compound Name | 9-cyclopropyl-6-fluoro-7-[2-(4-methoxyphenyl)ethynyl]-[1,2]thiazolo[5,4-b]quinoline-3,4-dione |
|---|---|
| PubChem CID | 58426832 |
| Molecular Formula | C22H15FN2O3S |
| Molecular Weight | 406.44 g/mol |
| Exact Mass | 406.08 |
| IUPAC Name | 9-cyclopropyl-6-fluoro-7-[2-(4-methoxyphenyl)ethynyl]-[1,2]thiazolo[5,4-b]quinoline-3,4-dione |
| SMILES | COc1ccc(C#Cc2cc3c(cc2F)c(=O)c2c(=O)[nH]sc2n3C2CC2)cc1 |
| InChI | InChI=1S/C22H15FN2O3S/c1-28-15-8-3-12(4-9-15)2-5-13-10-18-16(11-17(13)23)20(26)19-21(27)24-29-22(19)25(18)14-6-7-14/h3-4,8-11,14H,6-7H2,1H3,(H,24,27) |
| InChIKey | VTQUNLWKGGZBKC-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 64.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.44 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|