C13H25ClN2O2Si — CID 58427120
chloromethyl-[[(2S,5R)-3,6-dimethoxy-5-propan-2-yl-2,5-dihydropyrazin-2-yl]methyl]-dimethylsilane (PubChem CID 58427120) has the molecular formula C13H25ClN2O2Si and a molecular weight of 304.89 g/mol. Its IUPAC name is chloromethyl-[[(2S,5R)-3,6-dimethoxy-5-propan-2-yl-2,5-dihydropyrazin-2-yl]methyl]-dimethylsilane.
| Compound Name | chloromethyl-[[(2S,5R)-3,6-dimethoxy-5-propan-2-yl-2,5-dihydropyrazin-2-yl]methyl]-dimethylsilane |
|---|---|
| PubChem CID | 58427120 |
| Molecular Formula | C13H25ClN2O2Si |
| Molecular Weight | 304.89 g/mol |
| Exact Mass | 304.14 |
| IUPAC Name | chloromethyl-[[(2S,5R)-3,6-dimethoxy-5-propan-2-yl-2,5-dihydropyrazin-2-yl]methyl]-dimethylsilane |
| SMILES | COC1=N[C@H](C(C)C)C(OC)=N[C@@H]1C[Si](C)(C)CCl |
| InChI | InChI=1S/C13H25ClN2O2Si/c1-9(2)11-13(18-4)15-10(12(16-11)17-3)7-19(5,6)8-14/h9-11H,7-8H2,1-6H3/t10-,11-/m1/s1 |
| InChIKey | WMBAMEGAFIAPGH-GHMZBOCLSA-N |
| XLogP | 2.97 |
| TPSA | 43.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.89 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|