C14H27ClN2O2Si — CID 58427174
[(2R,5R)-5-[[2-chloroethyl(dimethyl)silyl]methyl]-6-methoxy-2-propan-2-yl-2,5-dihydropyrazin-3-yl]methanol (PubChem CID 58427174) has the molecular formula C14H27ClN2O2Si and a molecular weight of 318.92 g/mol. Its IUPAC name is [(2R,5R)-5-[[2-chloroethyl(dimethyl)silyl]methyl]-6-methoxy-2-propan-2-yl-2,5-dihydropyrazin-3-yl]methanol.
| Compound Name | [(2R,5R)-5-[[2-chloroethyl(dimethyl)silyl]methyl]-6-methoxy-2-propan-2-yl-2,5-dihydropyrazin-3-yl]methanol |
|---|---|
| PubChem CID | 58427174 |
| Molecular Formula | C14H27ClN2O2Si |
| Molecular Weight | 318.92 g/mol |
| Exact Mass | 318.15 |
| IUPAC Name | [(2R,5R)-5-[[2-chloroethyl(dimethyl)silyl]methyl]-6-methoxy-2-propan-2-yl-2,5-dihydropyrazin-3-yl]methanol |
| SMILES | COC1=N[C@H](C(C)C)C(CO)=N[C@H]1C[Si](C)(C)CCCl |
| InChI | InChI=1S/C14H27ClN2O2Si/c1-10(2)13-11(8-18)16-12(14(17-13)19-3)9-20(4,5)7-6-15/h10,12-13,18H,6-9H2,1-5H3/t12-,13+/m0/s1 |
| InChIKey | GYNXBKQOIFTPET-QWHCGFSZSA-N |
| XLogP | 2.82 |
| TPSA | 54.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.92 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|