C26H32BF2N3O4 — CID 58427177
tert-butyl 4,4-difluoro-2-[7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3H-benzo[e]benzimidazol-2-yl]pyrrolidine-1-carboxylate (PubChem CID 58427177) has the molecular formula C26H32BF2N3O4 and a molecular weight of 499.37 g/mol. Its IUPAC name is tert-butyl 4,4-difluoro-2-[7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3H-benzo[e]benzimidazol-2-yl]pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl 4,4-difluoro-2-[7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3H-benzo[e]benzimidazol-2-yl]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 58427177 |
| Molecular Formula | C26H32BF2N3O4 |
| Molecular Weight | 499.37 g/mol |
| Exact Mass | 499.25 |
| IUPAC Name | tert-butyl 4,4-difluoro-2-[7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3H-benzo[e]benzimidazol-2-yl]pyrrolidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CC(F)(F)CC1c1nc2c(ccc3cc(B4OC(C)(C)C(C)(C)O4)ccc32)[nH]1 |
| InChI | InChI=1S/C26H32BF2N3O4/c1-23(2,3)34-22(33)32-14-26(28,29)13-19(32)21-30-18-11-8-15-12-16(9-10-17(15)20(18)31-21)27-35-24(4,5)25(6,7)36-27/h8-12,19H,13-14H2,1-7H3,(H,30,31) |
| InChIKey | PBAKKNYUPWNHFJ-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 76.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.37 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|