About tert-butyl (2S)-4,4-difluoro-2-(7-methyl-3H-benzo[e]benzimidazol-2-yl)pyrrolidine-1-carboxylate
tert-butyl (2S)-4,4-difluoro-2-(7-methyl-3H-benzo[e]benzimidazol-2-yl)pyrrolidine-1-carboxylate (PubChem CID 58427181) has the molecular formula C21H23F2N3O2
and a molecular weight of 387.43 g/mol. Its IUPAC name is tert-butyl (2S)-4,4-difluoro-2-(7-methyl-3H-benzo[e]benzimidazol-2-yl)pyrrolidine-1-carboxylate.
Molecular Properties
| Compound Name | tert-butyl (2S)-4,4-difluoro-2-(7-methyl-3H-benzo[e]benzimidazol-2-yl)pyrrolidine-1-carboxylate |
| PubChem CID | 58427181 |
| Molecular Formula | C21H23F2N3O2 |
| Molecular Weight | 387.43 g/mol |
| Exact Mass | 387.18 |
| IUPAC Name | tert-butyl (2S)-4,4-difluoro-2-(7-methyl-3H-benzo[e]benzimidazol-2-yl)pyrrolidine-1-carboxylate |
| SMILES | Cc1ccc2c(ccc3[nH]c([C@@H]4CC(F)(F)CN4C(=O)OC(C)(C)C)nc32)c1 |
| InChI | InChI=1S/C21H23F2N3O2/c1-12-5-7-14-13(9-12)6-8-15-17(14)25-18(24-15)16-10-21(22,23)11-26(16)19(27)28-20(2,3)4/h5-9,16H,10-11H2,1-4H3,(H,24,25)/t16-/m0/s1 |
| InChIKey | WYAYFAUFMGUNAL-INIZCTEOSA-N |
| XLogP | 5.34 |
| TPSA | 58.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 387.43 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze tert-butyl (2S)-4,4-difluoro-2-(7-methyl-3H-benzo[e]benzimidazol-2-yl)pyrrolidine-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl (2S)-4,4-difluoro-2-(7-methyl-3H-benzo[e]benzimidazol-2-yl)pyrrolidine-1-carboxylate?
The IUPAC name of tert-butyl (2S)-4,4-difluoro-2-(7-methyl-3H-benzo[e]benzimidazol-2-yl)pyrrolidine-1-carboxylate (CID 58427181) is tert-butyl (2S)-4,4-difluoro-2-(7-methyl-3H-benzo[e]benzimidazol-2-yl)pyrrolidine-1-carboxylate.
What is the SMILES notation for tert-butyl (2S)-4,4-difluoro-2-(7-methyl-3H-benzo[e]benzimidazol-2-yl)pyrrolidine-1-carboxylate?
The canonical SMILES for tert-butyl (2S)-4,4-difluoro-2-(7-methyl-3H-benzo[e]benzimidazol-2-yl)pyrrolidine-1-carboxylate is Cc1ccc2c(ccc3[nH]c([C@@H]4CC(F)(F)CN4C(=O)OC(C)(C)C)nc32)c1.
What is the InChIKey of tert-butyl (2S)-4,4-difluoro-2-(7-methyl-3H-benzo[e]benzimidazol-2-yl)pyrrolidine-1-carboxylate?
The InChIKey is WYAYFAUFMGUNAL-INIZCTEOSA-N. The full InChI is InChI=1S/C21H23F2N3O2/c1-12-5-7-14-13(9-12)6-8-15-17(14)25-18(24-15)16-10-21(22,23)11-26(16)19(27)28-20(2,3)4/h5-9,16H,10-11H2,1-4H3,(H,24,25)/t16-/m0/s1.
What are the key properties of tert-butyl (2S)-4,4-difluoro-2-(7-methyl-3H-benzo[e]benzimidazol-2-yl)pyrrolidine-1-carboxylate?
tert-butyl (2S)-4,4-difluoro-2-(7-methyl-3H-benzo[e]benzimidazol-2-yl)pyrrolidine-1-carboxylate has a molecular weight of 387.43 g/mol, XLogP of 5.34, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl (2S)-4,4-difluoro-2-(7-methyl-3H-benzo[e]benzimidazol-2-yl)pyrrolidine-1-carboxylate is sourced from PubChem (CID 58427181), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).