C31H34N4Si — CID 58427217
2-cyclopentyl-7-[4-[2-[(3R)-1,1-dimethylsilolan-3-yl]-1H-imidazol-5-yl]phenyl]-3H-benzo[e]benzimidazole (PubChem CID 58427217) has the molecular formula C31H34N4Si and a molecular weight of 490.73 g/mol. Its IUPAC name is 2-cyclopentyl-7-[4-[2-[(3R)-1,1-dimethylsilolan-3-yl]-1H-imidazol-5-yl]phenyl]-3H-benzo[e]benzimidazole.
| Compound Name | 2-cyclopentyl-7-[4-[2-[(3R)-1,1-dimethylsilolan-3-yl]-1H-imidazol-5-yl]phenyl]-3H-benzo[e]benzimidazole |
|---|---|
| PubChem CID | 58427217 |
| Molecular Formula | C31H34N4Si |
| Molecular Weight | 490.73 g/mol |
| Exact Mass | 490.26 |
| IUPAC Name | 2-cyclopentyl-7-[4-[2-[(3R)-1,1-dimethylsilolan-3-yl]-1H-imidazol-5-yl]phenyl]-3H-benzo[e]benzimidazole |
| SMILES | C[Si]1(C)CC[C@H](c2ncc(-c3ccc(-c4ccc5c(ccc6[nH]c(C7CCCC7)nc65)c4)cc3)[nH]2)C1 |
| InChI | InChI=1S/C31H34N4Si/c1-36(2)16-15-25(19-36)30-32-18-28(34-30)21-9-7-20(8-10-21)23-11-13-26-24(17-23)12-14-27-29(26)35-31(33-27)22-5-3-4-6-22/h7-14,17-18,22,25H,3-6,15-16,19H2,1-2H3,(H,32,34)(H,33,35)/t25-/m0/s1 |
| InChIKey | ZQWURIFMDSZGCL-VWLOTQADSA-N |
| XLogP | 8.63 |
| TPSA | 57.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.73 |
| LogP ≤ 5 | 8.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|