C30H24F4N2O2 — CID 58427658
3-phenyl-6-[1,2,2,2-tetrafluoro-1-(3-phenyl-2,4-dihydro-1,3-benzoxazin-6-yl)ethyl]-2,4-dihydro-1,3-benzoxazine (PubChem CID 58427658) has the molecular formula C30H24F4N2O2 and a molecular weight of 520.53 g/mol. Its IUPAC name is 3-phenyl-6-[1,2,2,2-tetrafluoro-1-(3-phenyl-2,4-dihydro-1,3-benzoxazin-6-yl)ethyl]-2,4-dihydro-1,3-benzoxazine.
| Compound Name | 3-phenyl-6-[1,2,2,2-tetrafluoro-1-(3-phenyl-2,4-dihydro-1,3-benzoxazin-6-yl)ethyl]-2,4-dihydro-1,3-benzoxazine |
|---|---|
| PubChem CID | 58427658 |
| Molecular Formula | C30H24F4N2O2 |
| Molecular Weight | 520.53 g/mol |
| Exact Mass | 520.18 |
| IUPAC Name | 3-phenyl-6-[1,2,2,2-tetrafluoro-1-(3-phenyl-2,4-dihydro-1,3-benzoxazin-6-yl)ethyl]-2,4-dihydro-1,3-benzoxazine |
| SMILES | FC(F)(F)C(F)(c1ccc2c(c1)CN(c1ccccc1)CO2)c1ccc2c(c1)CN(c1ccccc1)CO2 |
| InChI | InChI=1S/C30H24F4N2O2/c31-29(30(32,33)34,23-11-13-27-21(15-23)17-35(19-37-27)25-7-3-1-4-8-25)24-12-14-28-22(16-24)18-36(20-38-28)26-9-5-2-6-10-26/h1-16H,17-20H2 |
| InChIKey | TZSVEGDZDIFHII-UHFFFAOYSA-N |
| XLogP | 7.18 |
| TPSA | 24.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.53 |
| LogP ≤ 5 | 7.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |