C28H14N8O4 — CID 58427820
4,9,18,23,31,32,33,36-octazanonacyclo[24.2.2.212,15.13,24.15,8.110,17.119,22.02,25.011,16]hexatriaconta-2(25),3(31),4,6,8,10(33),11(16),17,19,21,23,29,34-tridecaene-13,14,27,28-tetrone (PubChem CID 58427820) has the molecular formula C28H14N8O4 and a molecular weight of 526.47 g/mol. Its IUPAC name is 4,9,18,23,31,32,33,36-octazanonacyclo[24.2.2.212,15.13,24.15,8.110,17.119,22.02,25.011,16]hexatriaconta-2(25),3(31),4,6,8,10(33),11(16),17,19,21,23,29,34-tridecaene-13,14,27,28-tetrone.
| Compound Name | 4,9,18,23,31,32,33,36-octazanonacyclo[24.2.2.212,15.13,24.15,8.110,17.119,22.02,25.011,16]hexatriaconta-2(25),3(31),4,6,8,10(33),11(16),17,19,21,23,29,34-tridecaene-13,14,27,28-tetrone |
|---|---|
| PubChem CID | 58427820 |
| Molecular Formula | C28H14N8O4 |
| Molecular Weight | 526.47 g/mol |
| Exact Mass | 526.11 |
| IUPAC Name | 4,9,18,23,31,32,33,36-octazanonacyclo[24.2.2.212,15.13,24.15,8.110,17.119,22.02,25.011,16]hexatriaconta-2(25),3(31),4,6,8,10(33),11(16),17,19,21,23,29,34-tridecaene-13,14,27,28-tetrone |
| SMILES | O=C1C(=O)C2C=CC1C1=C2c2nc1nc1ccc(nc3nc(nc4ccc(n2)[nH]4)C2=C3C3C=CC2C(=O)C3=O)[nH]1 |
| InChI | InChI=1S/C28H14N8O4/c37-21-9-1-2-10(22(21)38)18-17(9)25-31-13-5-6-15(29-13)33-27-19-11-3-4-12(24(40)23(11)39)20(19)28(36-27)34-16-8-7-14(30-16)32-26(18)35-25/h1-12H,(H2,29,30,31,32,33,34,35,36) |
| InChIKey | ZQKBNKZBJPMOSP-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 177.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.47 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|