C22H14N8O — CID 58427844
(22S)-4,9,14,19,27,28,29,30-octazaheptacyclo[20.2.2.13,20.15,8.110,13.115,18.02,21]triaconta-2(21),3,5,7,9,11,13,15(28),16,18,20(27),25-dodecaen-23-one (PubChem CID 58427844) has the molecular formula C22H14N8O and a molecular weight of 406.41 g/mol. Its IUPAC name is (22S)-4,9,14,19,27,28,29,30-octazaheptacyclo[20.2.2.13,20.15,8.110,13.115,18.02,21]triaconta-2(21),3,5,7,9,11,13,15(28),16,18,20(27),25-dodecaen-23-one.
| Compound Name | (22S)-4,9,14,19,27,28,29,30-octazaheptacyclo[20.2.2.13,20.15,8.110,13.115,18.02,21]triaconta-2(21),3,5,7,9,11,13,15(28),16,18,20(27),25-dodecaen-23-one |
|---|---|
| PubChem CID | 58427844 |
| Molecular Formula | C22H14N8O |
| Molecular Weight | 406.41 g/mol |
| Exact Mass | 406.13 |
| IUPAC Name | (22S)-4,9,14,19,27,28,29,30-octazaheptacyclo[20.2.2.13,20.15,8.110,13.115,18.02,21]triaconta-2(21),3,5,7,9,11,13,15(28),16,18,20(27),25-dodecaen-23-one |
| SMILES | O=C1CC2C=C[C@H]1C1=C2c2nc1nc1nc(nc3ccc(nc4ccc(n2)[nH]4)[nH]3)C=C1 |
| InChI | InChI=1S/C22H14N8O/c31-12-9-10-1-2-11(12)20-19(10)21-28-17-7-5-15(26-17)24-13-3-4-14(23-13)25-16-6-8-18(27-16)29-22(20)30-21/h1-8,10-11H,9H2,(H2,23,24,25,26,27,28,29,30)/t10?,11-/m1/s1 |
| InChIKey | NJNGLCFRENYOEC-RRKGBCIJSA-N |
| XLogP | 2.75 |
| TPSA | 125.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.41 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|