C17H18N2O2 — CID 58427858
11,11-dimethyl-10,12-dioxatetracyclo[6.5.2.02,7.09,13]pentadeca-4,14-diene-4,5-dicarbonitrile (PubChem CID 58427858) has the molecular formula C17H18N2O2 and a molecular weight of 282.34 g/mol. Its IUPAC name is 11,11-dimethyl-10,12-dioxatetracyclo[6.5.2.02,7.09,13]pentadeca-4,14-diene-4,5-dicarbonitrile.
| Compound Name | 11,11-dimethyl-10,12-dioxatetracyclo[6.5.2.02,7.09,13]pentadeca-4,14-diene-4,5-dicarbonitrile |
|---|---|
| PubChem CID | 58427858 |
| Molecular Formula | C17H18N2O2 |
| Molecular Weight | 282.34 g/mol |
| Exact Mass | 282.14 |
| IUPAC Name | 11,11-dimethyl-10,12-dioxatetracyclo[6.5.2.02,7.09,13]pentadeca-4,14-diene-4,5-dicarbonitrile |
| SMILES | CC1(C)OC2C3C=CC(C4CC(C#N)=C(C#N)CC34)C2O1 |
| InChI | InChI=1S/C17H18N2O2/c1-17(2)20-15-11-3-4-12(16(15)21-17)14-6-10(8-19)9(7-18)5-13(11)14/h3-4,11-16H,5-6H2,1-2H3 |
| InChIKey | PZKWZMQGRUKRHN-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 66.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.34 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|