C13H16O2 — CID 58427903
4,4-dimethyl-10,11-dimethylidene-3,5-dioxatricyclo[5.2.2.02,6]undec-8-ene (PubChem CID 58427903) has the molecular formula C13H16O2 and a molecular weight of 204.27 g/mol. Its IUPAC name is 4,4-dimethyl-10,11-dimethylidene-3,5-dioxatricyclo[5.2.2.02,6]undec-8-ene.
| Compound Name | 4,4-dimethyl-10,11-dimethylidene-3,5-dioxatricyclo[5.2.2.02,6]undec-8-ene |
|---|---|
| PubChem CID | 58427903 |
| Molecular Formula | C13H16O2 |
| Molecular Weight | 204.27 g/mol |
| Exact Mass | 204.12 |
| IUPAC Name | 4,4-dimethyl-10,11-dimethylidene-3,5-dioxatricyclo[5.2.2.02,6]undec-8-ene |
| SMILES | C=C1C(=C)C2C=CC1C1OC(C)(C)OC21 |
| InChI | InChI=1S/C13H16O2/c1-7-8(2)10-6-5-9(7)11-12(10)15-13(3,4)14-11/h5-6,9-12H,1-2H2,3-4H3 |
| InChIKey | IQMURQRPZRVASB-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.27 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|