C28H18N8O2 — CID 58427906
4,9,18,23,31,32,33,36-octazanonacyclo[24.2.2.212,15.13,24.15,8.110,17.119,22.02,25.011,16]hexatriaconta-2(25),3(31),4,6,8,10(33),11(16),17,19,21,23,29,34-tridecaene-13,27-dione (PubChem CID 58427906) has the molecular formula C28H18N8O2 and a molecular weight of 498.51 g/mol. Its IUPAC name is 4,9,18,23,31,32,33,36-octazanonacyclo[24.2.2.212,15.13,24.15,8.110,17.119,22.02,25.011,16]hexatriaconta-2(25),3(31),4,6,8,10(33),11(16),17,19,21,23,29,34-tridecaene-13,27-dione.
| Compound Name | 4,9,18,23,31,32,33,36-octazanonacyclo[24.2.2.212,15.13,24.15,8.110,17.119,22.02,25.011,16]hexatriaconta-2(25),3(31),4,6,8,10(33),11(16),17,19,21,23,29,34-tridecaene-13,27-dione |
|---|---|
| PubChem CID | 58427906 |
| Molecular Formula | C28H18N8O2 |
| Molecular Weight | 498.51 g/mol |
| Exact Mass | 498.16 |
| IUPAC Name | 4,9,18,23,31,32,33,36-octazanonacyclo[24.2.2.212,15.13,24.15,8.110,17.119,22.02,25.011,16]hexatriaconta-2(25),3(31),4,6,8,10(33),11(16),17,19,21,23,29,34-tridecaene-13,27-dione |
| SMILES | O=C1CC2C=CC1C1=C2c2nc1nc1ccc(nc3nc(nc4ccc(n2)[nH]4)C2=C3C3C=CC2C(=O)C3)[nH]1 |
| InChI | InChI=1S/C28H18N8O2/c37-15-9-11-1-3-13(15)23-21(11)25-31-17-5-7-20(29-17)34-28-24-14-4-2-12(10-16(14)38)22(24)26(36-28)32-18-6-8-19(30-18)33-27(23)35-25/h1-8,11-14H,9-10H2,(H2,29,30,31,32,33,34,35,36) |
| InChIKey | LXDWBEBRWDIGHV-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 143.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | |
| Heavy Atoms | 38 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.51 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|