About methyl 4-[[2-(2-chloro-4,6-dimethylphenyl)acetyl]-hydroxyamino]-1-methoxypiperidine-4-carboxylate
methyl 4-[[2-(2-chloro-4,6-dimethylphenyl)acetyl]-hydroxyamino]-1-methoxypiperidine-4-carboxylate (PubChem CID 58427969) has the molecular formula C18H25ClN2O5
and a molecular weight of 384.86 g/mol. Its IUPAC name is methyl 4-[[2-(2-chloro-4,6-dimethylphenyl)acetyl]-hydroxyamino]-1-methoxypiperidine-4-carboxylate.
Molecular Properties
| Compound Name | methyl 4-[[2-(2-chloro-4,6-dimethylphenyl)acetyl]-hydroxyamino]-1-methoxypiperidine-4-carboxylate |
| PubChem CID | 58427969 |
| Molecular Formula | C18H25ClN2O5 |
| Molecular Weight | 384.86 g/mol |
| Exact Mass | 384.15 |
| IUPAC Name | methyl 4-[[2-(2-chloro-4,6-dimethylphenyl)acetyl]-hydroxyamino]-1-methoxypiperidine-4-carboxylate |
| SMILES | COC(=O)C1(N(O)C(=O)Cc2c(C)cc(C)cc2Cl)CCN(OC)CC1 |
| InChI | InChI=1S/C18H25ClN2O5/c1-12-9-13(2)14(15(19)10-12)11-16(22)21(24)18(17(23)25-3)5-7-20(26-4)8-6-18/h9-10,24H,5-8,11H2,1-4H3 |
| InChIKey | JLIYJLVLUGWGIN-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 79.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 384.86 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze methyl 4-[[2-(2-chloro-4,6-dimethylphenyl)acetyl]-hydroxyamino]-1-methoxypiperidine-4-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 4-[[2-(2-chloro-4,6-dimethylphenyl)acetyl]-hydroxyamino]-1-methoxypiperidine-4-carboxylate?
The IUPAC name of methyl 4-[[2-(2-chloro-4,6-dimethylphenyl)acetyl]-hydroxyamino]-1-methoxypiperidine-4-carboxylate (CID 58427969) is methyl 4-[[2-(2-chloro-4,6-dimethylphenyl)acetyl]-hydroxyamino]-1-methoxypiperidine-4-carboxylate.
What is the SMILES notation for methyl 4-[[2-(2-chloro-4,6-dimethylphenyl)acetyl]-hydroxyamino]-1-methoxypiperidine-4-carboxylate?
The canonical SMILES for methyl 4-[[2-(2-chloro-4,6-dimethylphenyl)acetyl]-hydroxyamino]-1-methoxypiperidine-4-carboxylate is COC(=O)C1(N(O)C(=O)Cc2c(C)cc(C)cc2Cl)CCN(OC)CC1.
What is the InChIKey of methyl 4-[[2-(2-chloro-4,6-dimethylphenyl)acetyl]-hydroxyamino]-1-methoxypiperidine-4-carboxylate?
The InChIKey is JLIYJLVLUGWGIN-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H25ClN2O5/c1-12-9-13(2)14(15(19)10-12)11-16(22)21(24)18(17(23)25-3)5-7-20(26-4)8-6-18/h9-10,24H,5-8,11H2,1-4H3.
What are the key properties of methyl 4-[[2-(2-chloro-4,6-dimethylphenyl)acetyl]-hydroxyamino]-1-methoxypiperidine-4-carboxylate?
methyl 4-[[2-(2-chloro-4,6-dimethylphenyl)acetyl]-hydroxyamino]-1-methoxypiperidine-4-carboxylate has a molecular weight of 384.86 g/mol, XLogP of 2.29, 5 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 4-[[2-(2-chloro-4,6-dimethylphenyl)acetyl]-hydroxyamino]-1-methoxypiperidine-4-carboxylate is sourced from PubChem (CID 58427969), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).