About [3-(2-chloro-6-fluoro-3-methylphenyl)-1,8-dimethoxy-2-oxo-1,8-diazaspiro[4.5]dec-3-en-4-yl] ethyl carbonate
[3-(2-chloro-6-fluoro-3-methylphenyl)-1,8-dimethoxy-2-oxo-1,8-diazaspiro[4.5]dec-3-en-4-yl] ethyl carbonate (PubChem CID 58427972) has the molecular formula C20H24ClFN2O6
and a molecular weight of 442.87 g/mol. Its IUPAC name is [3-(2-chloro-6-fluoro-3-methylphenyl)-1,8-dimethoxy-2-oxo-1,8-diazaspiro[4.5]dec-3-en-4-yl] ethyl carbonate.
Molecular Properties
| Compound Name | [3-(2-chloro-6-fluoro-3-methylphenyl)-1,8-dimethoxy-2-oxo-1,8-diazaspiro[4.5]dec-3-en-4-yl] ethyl carbonate |
| PubChem CID | 58427972 |
| Molecular Formula | C20H24ClFN2O6 |
| Molecular Weight | 442.87 g/mol |
| Exact Mass | 442.13 |
| IUPAC Name | [3-(2-chloro-6-fluoro-3-methylphenyl)-1,8-dimethoxy-2-oxo-1,8-diazaspiro[4.5]dec-3-en-4-yl] ethyl carbonate |
| SMILES | CCOC(=O)OC1=C(c2c(F)ccc(C)c2Cl)C(=O)N(OC)C12CCN(OC)CC2 |
| InChI | InChI=1S/C20H24ClFN2O6/c1-5-29-19(26)30-17-15(14-13(22)7-6-12(2)16(14)21)18(25)24(28-4)20(17)8-10-23(27-3)11-9-20/h6-7H,5,8-11H2,1-4H3 |
| InChIKey | ZZHWOORKSUDNGZ-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 77.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 442.87 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze [3-(2-chloro-6-fluoro-3-methylphenyl)-1,8-dimethoxy-2-oxo-1,8-diazaspiro[4.5]dec-3-en-4-yl] ethyl carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-(2-chloro-6-fluoro-3-methylphenyl)-1,8-dimethoxy-2-oxo-1,8-diazaspiro[4.5]dec-3-en-4-yl] ethyl carbonate?
The IUPAC name of [3-(2-chloro-6-fluoro-3-methylphenyl)-1,8-dimethoxy-2-oxo-1,8-diazaspiro[4.5]dec-3-en-4-yl] ethyl carbonate (CID 58427972) is [3-(2-chloro-6-fluoro-3-methylphenyl)-1,8-dimethoxy-2-oxo-1,8-diazaspiro[4.5]dec-3-en-4-yl] ethyl carbonate.
What is the SMILES notation for [3-(2-chloro-6-fluoro-3-methylphenyl)-1,8-dimethoxy-2-oxo-1,8-diazaspiro[4.5]dec-3-en-4-yl] ethyl carbonate?
The canonical SMILES for [3-(2-chloro-6-fluoro-3-methylphenyl)-1,8-dimethoxy-2-oxo-1,8-diazaspiro[4.5]dec-3-en-4-yl] ethyl carbonate is CCOC(=O)OC1=C(c2c(F)ccc(C)c2Cl)C(=O)N(OC)C12CCN(OC)CC2.
What is the InChIKey of [3-(2-chloro-6-fluoro-3-methylphenyl)-1,8-dimethoxy-2-oxo-1,8-diazaspiro[4.5]dec-3-en-4-yl] ethyl carbonate?
The InChIKey is ZZHWOORKSUDNGZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H24ClFN2O6/c1-5-29-19(26)30-17-15(14-13(22)7-6-12(2)16(14)21)18(25)24(28-4)20(17)8-10-23(27-3)11-9-20/h6-7H,5,8-11H2,1-4H3.
What are the key properties of [3-(2-chloro-6-fluoro-3-methylphenyl)-1,8-dimethoxy-2-oxo-1,8-diazaspiro[4.5]dec-3-en-4-yl] ethyl carbonate?
[3-(2-chloro-6-fluoro-3-methylphenyl)-1,8-dimethoxy-2-oxo-1,8-diazaspiro[4.5]dec-3-en-4-yl] ethyl carbonate has a molecular weight of 442.87 g/mol, XLogP of 3.47, 5 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for [3-(2-chloro-6-fluoro-3-methylphenyl)-1,8-dimethoxy-2-oxo-1,8-diazaspiro[4.5]dec-3-en-4-yl] ethyl carbonate is sourced from PubChem (CID 58427972), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).