C23H30N5O8P — CID 58428229
N-[(2R)-1-[hexyl-(4-nitrophenoxy)phosphoryl]oxy-3-methylbutan-2-yl]-4-nitro-2,1,3-benzoxadiazol-7-amine (PubChem CID 58428229) has the molecular formula C23H30N5O8P and a molecular weight of 535.49 g/mol. Its IUPAC name is N-[(2R)-1-[hexyl-(4-nitrophenoxy)phosphoryl]oxy-3-methylbutan-2-yl]-4-nitro-2,1,3-benzoxadiazol-7-amine.
| Compound Name | N-[(2R)-1-[hexyl-(4-nitrophenoxy)phosphoryl]oxy-3-methylbutan-2-yl]-4-nitro-2,1,3-benzoxadiazol-7-amine |
|---|---|
| PubChem CID | 58428229 |
| Molecular Formula | C23H30N5O8P |
| Molecular Weight | 535.49 g/mol |
| Exact Mass | 535.18 |
| IUPAC Name | N-[(2R)-1-[hexyl-(4-nitrophenoxy)phosphoryl]oxy-3-methylbutan-2-yl]-4-nitro-2,1,3-benzoxadiazol-7-amine |
| SMILES | CCCCCCP(=O)(OC[C@H](Nc1ccc([N+](=O)[O-])c2nonc12)C(C)C)Oc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C23H30N5O8P/c1-4-5-6-7-14-37(33,35-18-10-8-17(9-11-18)27(29)30)34-15-20(16(2)3)24-19-12-13-21(28(31)32)23-22(19)25-36-26-23/h8-13,16,20,24H,4-7,14-15H2,1-3H3/t20-,37?/m0/s1 |
| InChIKey | ADPMUPWMDMUXJM-PTJRXNEBSA-N |
| XLogP | 6.34 |
| TPSA | 172.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 37 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.49 |
| LogP ≤ 5 | 6.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|