C18H20N5O8P — CID 58428230
N-[3-methyl-1-[methyl-(4-nitrophenoxy)phosphoryl]oxybutan-2-yl]-4-nitro-2,1,3-benzoxadiazol-7-amine (PubChem CID 58428230) has the molecular formula C18H20N5O8P and a molecular weight of 465.36 g/mol. Its IUPAC name is N-[3-methyl-1-[methyl-(4-nitrophenoxy)phosphoryl]oxybutan-2-yl]-4-nitro-2,1,3-benzoxadiazol-7-amine.
| Compound Name | N-[3-methyl-1-[methyl-(4-nitrophenoxy)phosphoryl]oxybutan-2-yl]-4-nitro-2,1,3-benzoxadiazol-7-amine |
|---|---|
| PubChem CID | 58428230 |
| Molecular Formula | C18H20N5O8P |
| Molecular Weight | 465.36 g/mol |
| Exact Mass | 465.10 |
| IUPAC Name | N-[3-methyl-1-[methyl-(4-nitrophenoxy)phosphoryl]oxybutan-2-yl]-4-nitro-2,1,3-benzoxadiazol-7-amine |
| SMILES | CC(C)C(COP(C)(=O)Oc1ccc([N+](=O)[O-])cc1)Nc1ccc([N+](=O)[O-])c2nonc12 |
| InChI | InChI=1S/C18H20N5O8P/c1-11(2)15(19-14-8-9-16(23(26)27)18-17(14)20-31-21-18)10-29-32(3,28)30-13-6-4-12(5-7-13)22(24)25/h4-9,11,15,19H,10H2,1-3H3 |
| InChIKey | BOEPRRAVWUHTKK-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 172.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.36 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|