About 2-[3-(2-fluorophenyl)piperidin-1-yl]-4-(trifluoromethyl)-1,3-oxazole-5-carboxylic acid
2-[3-(2-fluorophenyl)piperidin-1-yl]-4-(trifluoromethyl)-1,3-oxazole-5-carboxylic acid (PubChem CID 58428591) has the molecular formula C16H14F4N2O3
and a molecular weight of 358.29 g/mol. Its IUPAC name is 2-[3-(2-fluorophenyl)piperidin-1-yl]-4-(trifluoromethyl)-1,3-oxazole-5-carboxylic acid.
Molecular Properties
| Compound Name | 2-[3-(2-fluorophenyl)piperidin-1-yl]-4-(trifluoromethyl)-1,3-oxazole-5-carboxylic acid |
| PubChem CID | 58428591 |
| Molecular Formula | C16H14F4N2O3 |
| Molecular Weight | 358.29 g/mol |
| Exact Mass | 358.09 |
| IUPAC Name | 2-[3-(2-fluorophenyl)piperidin-1-yl]-4-(trifluoromethyl)-1,3-oxazole-5-carboxylic acid |
| SMILES | O=C(O)c1oc(N2CCCC(c3ccccc3F)C2)nc1C(F)(F)F |
| InChI | InChI=1S/C16H14F4N2O3/c17-11-6-2-1-5-10(11)9-4-3-7-22(8-9)15-21-13(16(18,19)20)12(25-15)14(23)24/h1-2,5-6,9H,3-4,7-8H2,(H,23,24) |
| InChIKey | HVAZUWRXDNOQAL-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 66.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 358.29 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-[3-(2-fluorophenyl)piperidin-1-yl]-4-(trifluoromethyl)-1,3-oxazole-5-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[3-(2-fluorophenyl)piperidin-1-yl]-4-(trifluoromethyl)-1,3-oxazole-5-carboxylic acid?
The IUPAC name of 2-[3-(2-fluorophenyl)piperidin-1-yl]-4-(trifluoromethyl)-1,3-oxazole-5-carboxylic acid (CID 58428591) is 2-[3-(2-fluorophenyl)piperidin-1-yl]-4-(trifluoromethyl)-1,3-oxazole-5-carboxylic acid.
What is the SMILES notation for 2-[3-(2-fluorophenyl)piperidin-1-yl]-4-(trifluoromethyl)-1,3-oxazole-5-carboxylic acid?
The canonical SMILES for 2-[3-(2-fluorophenyl)piperidin-1-yl]-4-(trifluoromethyl)-1,3-oxazole-5-carboxylic acid is O=C(O)c1oc(N2CCCC(c3ccccc3F)C2)nc1C(F)(F)F.
What is the InChIKey of 2-[3-(2-fluorophenyl)piperidin-1-yl]-4-(trifluoromethyl)-1,3-oxazole-5-carboxylic acid?
The InChIKey is HVAZUWRXDNOQAL-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H14F4N2O3/c17-11-6-2-1-5-10(11)9-4-3-7-22(8-9)15-21-13(16(18,19)20)12(25-15)14(23)24/h1-2,5-6,9H,3-4,7-8H2,(H,23,24).
What are the key properties of 2-[3-(2-fluorophenyl)piperidin-1-yl]-4-(trifluoromethyl)-1,3-oxazole-5-carboxylic acid?
2-[3-(2-fluorophenyl)piperidin-1-yl]-4-(trifluoromethyl)-1,3-oxazole-5-carboxylic acid has a molecular weight of 358.29 g/mol, XLogP of 3.91, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[3-(2-fluorophenyl)piperidin-1-yl]-4-(trifluoromethyl)-1,3-oxazole-5-carboxylic acid is sourced from PubChem (CID 58428591), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).