C29H31F3N6O5 — CID 58428710
1-[2-(3-methylpiperidin-1-yl)-4-(trifluoromethyl)-1,3-oxazol-5-yl]-2-[6-[4-[2-(2-nitrophenyl)acetyl]piperazin-1-yl]-3-pyridinyl]ethanone (PubChem CID 58428710) has the molecular formula C29H31F3N6O5 and a molecular weight of 600.60 g/mol. Its IUPAC name is 1-[2-(3-methylpiperidin-1-yl)-4-(trifluoromethyl)-1,3-oxazol-5-yl]-2-[6-[4-[2-(2-nitrophenyl)acetyl]piperazin-1-yl]-3-pyridinyl]ethanone.
| Compound Name | 1-[2-(3-methylpiperidin-1-yl)-4-(trifluoromethyl)-1,3-oxazol-5-yl]-2-[6-[4-[2-(2-nitrophenyl)acetyl]piperazin-1-yl]-3-pyridinyl]ethanone |
|---|---|
| PubChem CID | 58428710 |
| Molecular Formula | C29H31F3N6O5 |
| Molecular Weight | 600.60 g/mol |
| Exact Mass | 600.23 |
| IUPAC Name | 1-[2-(3-methylpiperidin-1-yl)-4-(trifluoromethyl)-1,3-oxazol-5-yl]-2-[6-[4-[2-(2-nitrophenyl)acetyl]piperazin-1-yl]-3-pyridinyl]ethanone |
| SMILES | CC1CCCN(c2nc(C(F)(F)F)c(C(=O)Cc3ccc(N4CCN(C(=O)Cc5ccccc5[N+](=O)[O-])CC4)nc3)o2)C1 |
| InChI | InChI=1S/C29H31F3N6O5/c1-19-5-4-10-37(18-19)28-34-27(29(30,31)32)26(43-28)23(39)15-20-8-9-24(33-17-20)35-11-13-36(14-12-35)25(40)16-21-6-2-3-7-22(21)38(41)42/h2-3,6-9,17,19H,4-5,10-16,18H2,1H3 |
| InChIKey | KYPKPLCIEVSJDI-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 125.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.60 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|