C34H33F3N6O5 — CID 58428963
2-[6-[4-[2-(2-nitrophenyl)acetyl]piperazin-1-yl]-3-pyridinyl]-1-[2-(4-phenylpiperidin-1-yl)-4-(trifluoromethyl)-1,3-oxazol-5-yl]ethanone (PubChem CID 58428963) has the molecular formula C34H33F3N6O5 and a molecular weight of 662.67 g/mol. Its IUPAC name is 2-[6-[4-[2-(2-nitrophenyl)acetyl]piperazin-1-yl]-3-pyridinyl]-1-[2-(4-phenylpiperidin-1-yl)-4-(trifluoromethyl)-1,3-oxazol-5-yl]ethanone.
| Compound Name | 2-[6-[4-[2-(2-nitrophenyl)acetyl]piperazin-1-yl]-3-pyridinyl]-1-[2-(4-phenylpiperidin-1-yl)-4-(trifluoromethyl)-1,3-oxazol-5-yl]ethanone |
|---|---|
| PubChem CID | 58428963 |
| Molecular Formula | C34H33F3N6O5 |
| Molecular Weight | 662.67 g/mol |
| Exact Mass | 662.25 |
| IUPAC Name | 2-[6-[4-[2-(2-nitrophenyl)acetyl]piperazin-1-yl]-3-pyridinyl]-1-[2-(4-phenylpiperidin-1-yl)-4-(trifluoromethyl)-1,3-oxazol-5-yl]ethanone |
| SMILES | O=C(Cc1ccc(N2CCN(C(=O)Cc3ccccc3[N+](=O)[O-])CC2)nc1)c1oc(N2CCC(c3ccccc3)CC2)nc1C(F)(F)F |
| InChI | InChI=1S/C34H33F3N6O5/c35-34(36,37)32-31(48-33(39-32)42-14-12-25(13-15-42)24-6-2-1-3-7-24)28(44)20-23-10-11-29(38-22-23)40-16-18-41(19-17-40)30(45)21-26-8-4-5-9-27(26)43(46)47/h1-11,22,25H,12-21H2 |
| InChIKey | DVMPEAPIESQGOG-UHFFFAOYSA-N |
| XLogP | 5.70 |
| TPSA | 125.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 662.67 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|