About 5-bromo-2-methylidene-2-oxo-1H-2λ6,3-benzothiazin-4-amine
5-bromo-2-methylidene-2-oxo-1H-2λ6,3-benzothiazin-4-amine (PubChem CID 58429236) has the molecular formula C9H9BrN2OS
and a molecular weight of 273.15 g/mol. Its IUPAC name is 5-bromo-2-methylidene-2-oxo-1H-2λ6,3-benzothiazin-4-amine.
Molecular Properties
| Compound Name | 5-bromo-2-methylidene-2-oxo-1H-2λ6,3-benzothiazin-4-amine |
| PubChem CID | 58429236 |
| Molecular Formula | C9H9BrN2OS |
| Molecular Weight | 273.15 g/mol |
| Exact Mass | 271.96 |
| IUPAC Name | 5-bromo-2-methylidene-2-oxo-1H-2λ6,3-benzothiazin-4-amine |
| SMILES | C=S1(=O)Cc2cccc(Br)c2C(N)=N1 |
| InChI | InChI=1S/C9H9BrN2OS/c1-14(13)5-6-3-2-4-7(10)8(6)9(11)12-14/h2-4H,1,5H2,(H2,11,12,13) |
| InChIKey | FWSCINREYGVNNU-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 55.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 273.15 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 5-bromo-2-methylidene-2-oxo-1H-2λ6,3-benzothiazin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-bromo-2-methylidene-2-oxo-1H-2λ6,3-benzothiazin-4-amine?
The IUPAC name of 5-bromo-2-methylidene-2-oxo-1H-2λ6,3-benzothiazin-4-amine (CID 58429236) is 5-bromo-2-methylidene-2-oxo-1H-2λ6,3-benzothiazin-4-amine.
What is the SMILES notation for 5-bromo-2-methylidene-2-oxo-1H-2λ6,3-benzothiazin-4-amine?
The canonical SMILES for 5-bromo-2-methylidene-2-oxo-1H-2λ6,3-benzothiazin-4-amine is C=S1(=O)Cc2cccc(Br)c2C(N)=N1.
What is the InChIKey of 5-bromo-2-methylidene-2-oxo-1H-2λ6,3-benzothiazin-4-amine?
The InChIKey is FWSCINREYGVNNU-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H9BrN2OS/c1-14(13)5-6-3-2-4-7(10)8(6)9(11)12-14/h2-4H,1,5H2,(H2,11,12,13).
What are the key properties of 5-bromo-2-methylidene-2-oxo-1H-2λ6,3-benzothiazin-4-amine?
5-bromo-2-methylidene-2-oxo-1H-2λ6,3-benzothiazin-4-amine has a molecular weight of 273.15 g/mol, XLogP of 1.30, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-bromo-2-methylidene-2-oxo-1H-2λ6,3-benzothiazin-4-amine is sourced from PubChem (CID 58429236), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).