About 5-methylsulfonyl-2,2-dioxo-1H-2λ6,3-benzothiazin-4-amine
5-methylsulfonyl-2,2-dioxo-1H-2λ6,3-benzothiazin-4-amine (PubChem CID 58429326) has the molecular formula C9H10N2O4S2
and a molecular weight of 274.32 g/mol. Its IUPAC name is 5-methylsulfonyl-2,2-dioxo-1H-2λ6,3-benzothiazin-4-amine.
Molecular Properties
| Compound Name | 5-methylsulfonyl-2,2-dioxo-1H-2λ6,3-benzothiazin-4-amine |
| PubChem CID | 58429326 |
| Molecular Formula | C9H10N2O4S2 |
| Molecular Weight | 274.32 g/mol |
| Exact Mass | 274.01 |
| IUPAC Name | 5-methylsulfonyl-2,2-dioxo-1H-2λ6,3-benzothiazin-4-amine |
| SMILES | CS(=O)(=O)c1cccc2c1C(N)=NS(=O)(=O)C2 |
| InChI | InChI=1S/C9H10N2O4S2/c1-16(12,13)7-4-2-3-6-5-17(14,15)11-9(10)8(6)7/h2-4H,5H2,1H3,(H2,10,11) |
| InChIKey | UHRVLOJXUDHEKY-UHFFFAOYSA-N |
| XLogP | -0.36 |
| TPSA | 106.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 274.32 |
| LogP ≤ 5 | -0.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 5-methylsulfonyl-2,2-dioxo-1H-2λ6,3-benzothiazin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-methylsulfonyl-2,2-dioxo-1H-2λ6,3-benzothiazin-4-amine?
The IUPAC name of 5-methylsulfonyl-2,2-dioxo-1H-2λ6,3-benzothiazin-4-amine (CID 58429326) is 5-methylsulfonyl-2,2-dioxo-1H-2λ6,3-benzothiazin-4-amine.
What is the SMILES notation for 5-methylsulfonyl-2,2-dioxo-1H-2λ6,3-benzothiazin-4-amine?
The canonical SMILES for 5-methylsulfonyl-2,2-dioxo-1H-2λ6,3-benzothiazin-4-amine is CS(=O)(=O)c1cccc2c1C(N)=NS(=O)(=O)C2.
What is the InChIKey of 5-methylsulfonyl-2,2-dioxo-1H-2λ6,3-benzothiazin-4-amine?
The InChIKey is UHRVLOJXUDHEKY-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10N2O4S2/c1-16(12,13)7-4-2-3-6-5-17(14,15)11-9(10)8(6)7/h2-4H,5H2,1H3,(H2,10,11).
What are the key properties of 5-methylsulfonyl-2,2-dioxo-1H-2λ6,3-benzothiazin-4-amine?
5-methylsulfonyl-2,2-dioxo-1H-2λ6,3-benzothiazin-4-amine has a molecular weight of 274.32 g/mol, XLogP of -0.36, 1 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-methylsulfonyl-2,2-dioxo-1H-2λ6,3-benzothiazin-4-amine is sourced from PubChem (CID 58429326), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).