About 2,2-dioxo-5-prop-1-en-2-yl-1H-2λ6,3-benzothiazin-4-amine
2,2-dioxo-5-prop-1-en-2-yl-1H-2λ6,3-benzothiazin-4-amine (PubChem CID 58429386) has the molecular formula C11H12N2O2S
and a molecular weight of 236.30 g/mol. Its IUPAC name is 2,2-dioxo-5-prop-1-en-2-yl-1H-2λ6,3-benzothiazin-4-amine.
Molecular Properties
| Compound Name | 2,2-dioxo-5-prop-1-en-2-yl-1H-2λ6,3-benzothiazin-4-amine |
| PubChem CID | 58429386 |
| Molecular Formula | C11H12N2O2S |
| Molecular Weight | 236.30 g/mol |
| Exact Mass | 236.06 |
| IUPAC Name | 2,2-dioxo-5-prop-1-en-2-yl-1H-2λ6,3-benzothiazin-4-amine |
| SMILES | C=C(C)c1cccc2c1C(N)=NS(=O)(=O)C2 |
| InChI | InChI=1S/C11H12N2O2S/c1-7(2)9-5-3-4-8-6-16(14,15)13-11(12)10(8)9/h3-5H,1,6H2,2H3,(H2,12,13) |
| InChIKey | MGOVISHXSQNRCB-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 72.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 236.30 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2,2-dioxo-5-prop-1-en-2-yl-1H-2λ6,3-benzothiazin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,2-dioxo-5-prop-1-en-2-yl-1H-2λ6,3-benzothiazin-4-amine?
The IUPAC name of 2,2-dioxo-5-prop-1-en-2-yl-1H-2λ6,3-benzothiazin-4-amine (CID 58429386) is 2,2-dioxo-5-prop-1-en-2-yl-1H-2λ6,3-benzothiazin-4-amine.
What is the SMILES notation for 2,2-dioxo-5-prop-1-en-2-yl-1H-2λ6,3-benzothiazin-4-amine?
The canonical SMILES for 2,2-dioxo-5-prop-1-en-2-yl-1H-2λ6,3-benzothiazin-4-amine is C=C(C)c1cccc2c1C(N)=NS(=O)(=O)C2.
What is the InChIKey of 2,2-dioxo-5-prop-1-en-2-yl-1H-2λ6,3-benzothiazin-4-amine?
The InChIKey is MGOVISHXSQNRCB-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H12N2O2S/c1-7(2)9-5-3-4-8-6-16(14,15)13-11(12)10(8)9/h3-5H,1,6H2,2H3,(H2,12,13).
What are the key properties of 2,2-dioxo-5-prop-1-en-2-yl-1H-2λ6,3-benzothiazin-4-amine?
2,2-dioxo-5-prop-1-en-2-yl-1H-2λ6,3-benzothiazin-4-amine has a molecular weight of 236.30 g/mol, XLogP of 1.27, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2,2-dioxo-5-prop-1-en-2-yl-1H-2λ6,3-benzothiazin-4-amine is sourced from PubChem (CID 58429386), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).