C8H5F7 — CID 584294
1,2,4,5,5,6,6-heptafluorobicyclo[2.2.2]oct-2-ene (PubChem CID 584294) has the molecular formula C8H5F7 and a molecular weight of 234.11 g/mol. Its IUPAC name is 1,2,4,5,5,6,6-heptafluorobicyclo[2.2.2]oct-2-ene.
| Compound Name | 1,2,4,5,5,6,6-heptafluorobicyclo[2.2.2]oct-2-ene |
|---|---|
| PubChem CID | 584294 |
| Molecular Formula | C8H5F7 |
| Molecular Weight | 234.11 g/mol |
| Exact Mass | 234.03 |
| IUPAC Name | 1,2,4,5,5,6,6-heptafluorobicyclo[2.2.2]oct-2-ene |
| SMILES | FC1=CC2(F)CCC1(F)C(F)(F)C2(F)F |
| InChI | InChI=1S/C8H5F7/c9-4-3-5(10)1-2-6(4,11)8(14,15)7(5,12)13/h3H,1-2H2 |
| InChIKey | AHDFXGSOUBRVAB-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.11 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|