About 3-[tert-butyl(dimethyl)silyl]-2,7-dimethyl-2H-pyrano[3,2-c]pyran-5-one
3-[tert-butyl(dimethyl)silyl]-2,7-dimethyl-2H-pyrano[3,2-c]pyran-5-one (PubChem CID 58429912) has the molecular formula C16H24O3Si
and a molecular weight of 292.45 g/mol. Its IUPAC name is 3-[tert-butyl(dimethyl)silyl]-2,7-dimethyl-2H-pyrano[3,2-c]pyran-5-one.
Molecular Properties
| Compound Name | 3-[tert-butyl(dimethyl)silyl]-2,7-dimethyl-2H-pyrano[3,2-c]pyran-5-one |
| PubChem CID | 58429912 |
| Molecular Formula | C16H24O3Si |
| Molecular Weight | 292.45 g/mol |
| Exact Mass | 292.15 |
| IUPAC Name | 3-[tert-butyl(dimethyl)silyl]-2,7-dimethyl-2H-pyrano[3,2-c]pyran-5-one |
| SMILES | Cc1cc2c(c(=O)o1)C=C([Si](C)(C)C(C)(C)C)C(C)O2 |
| InChI | InChI=1S/C16H24O3Si/c1-10-8-13-12(15(17)18-10)9-14(11(2)19-13)20(6,7)16(3,4)5/h8-9,11H,1-7H3 |
| InChIKey | HNJRDWKNSRNZJD-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 39.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 292.45 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 3-[tert-butyl(dimethyl)silyl]-2,7-dimethyl-2H-pyrano[3,2-c]pyran-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[tert-butyl(dimethyl)silyl]-2,7-dimethyl-2H-pyrano[3,2-c]pyran-5-one?
The IUPAC name of 3-[tert-butyl(dimethyl)silyl]-2,7-dimethyl-2H-pyrano[3,2-c]pyran-5-one (CID 58429912) is 3-[tert-butyl(dimethyl)silyl]-2,7-dimethyl-2H-pyrano[3,2-c]pyran-5-one.
What is the SMILES notation for 3-[tert-butyl(dimethyl)silyl]-2,7-dimethyl-2H-pyrano[3,2-c]pyran-5-one?
The canonical SMILES for 3-[tert-butyl(dimethyl)silyl]-2,7-dimethyl-2H-pyrano[3,2-c]pyran-5-one is Cc1cc2c(c(=O)o1)C=C([Si](C)(C)C(C)(C)C)C(C)O2.
What is the InChIKey of 3-[tert-butyl(dimethyl)silyl]-2,7-dimethyl-2H-pyrano[3,2-c]pyran-5-one?
The InChIKey is HNJRDWKNSRNZJD-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H24O3Si/c1-10-8-13-12(15(17)18-10)9-14(11(2)19-13)20(6,7)16(3,4)5/h8-9,11H,1-7H3.
What are the key properties of 3-[tert-butyl(dimethyl)silyl]-2,7-dimethyl-2H-pyrano[3,2-c]pyran-5-one?
3-[tert-butyl(dimethyl)silyl]-2,7-dimethyl-2H-pyrano[3,2-c]pyran-5-one has a molecular weight of 292.45 g/mol, XLogP of 4.16, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[tert-butyl(dimethyl)silyl]-2,7-dimethyl-2H-pyrano[3,2-c]pyran-5-one is sourced from PubChem (CID 58429912), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).