About 5,6-dihydro-2H-imidazo[1,2-a]pyridin-4-ium
5,6-dihydro-2H-imidazo[1,2-a]pyridin-4-ium (PubChem CID 58430086) has the molecular formula C7H9N2+
and a molecular weight of 121.16 g/mol. Its IUPAC name is 5,6-dihydro-2H-imidazo[1,2-a]pyridin-4-ium.
Molecular Properties
| Compound Name | 5,6-dihydro-2H-imidazo[1,2-a]pyridin-4-ium |
| PubChem CID | 58430086 |
| Molecular Formula | C7H9N2+ |
| Molecular Weight | 121.16 g/mol |
| Exact Mass | 121.08 |
| IUPAC Name | 5,6-dihydro-2H-imidazo[1,2-a]pyridin-4-ium |
| SMILES | C1=CC2=NCC=[N+]2CC1 |
| InChI | InChI=1S/C7H9N2/c1-2-5-9-6-4-8-7(9)3-1/h1,3,6H,2,4-5H2/q+1 |
| InChIKey | CWPBPUIPYQVGOK-UHFFFAOYSA-N |
| XLogP | 0.44 |
| TPSA | 15.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 121.16 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze 5,6-dihydro-2H-imidazo[1,2-a]pyridin-4-ium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5,6-dihydro-2H-imidazo[1,2-a]pyridin-4-ium?
The IUPAC name of 5,6-dihydro-2H-imidazo[1,2-a]pyridin-4-ium (CID 58430086) is 5,6-dihydro-2H-imidazo[1,2-a]pyridin-4-ium.
What is the SMILES notation for 5,6-dihydro-2H-imidazo[1,2-a]pyridin-4-ium?
The canonical SMILES for 5,6-dihydro-2H-imidazo[1,2-a]pyridin-4-ium is C1=CC2=NCC=[N+]2CC1.
What is the InChIKey of 5,6-dihydro-2H-imidazo[1,2-a]pyridin-4-ium?
The InChIKey is CWPBPUIPYQVGOK-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H9N2/c1-2-5-9-6-4-8-7(9)3-1/h1,3,6H,2,4-5H2/q+1.
What are the key properties of 5,6-dihydro-2H-imidazo[1,2-a]pyridin-4-ium?
5,6-dihydro-2H-imidazo[1,2-a]pyridin-4-ium has a molecular weight of 121.16 g/mol, XLogP of 0.44, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 5,6-dihydro-2H-imidazo[1,2-a]pyridin-4-ium is sourced from PubChem (CID 58430086), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).