About (1-tert-butylcyclohexyl) ethyl carbonate
(1-tert-butylcyclohexyl) ethyl carbonate (PubChem CID 58430320) has the molecular formula C13H24O3
and a molecular weight of 228.33 g/mol. Its IUPAC name is (1-tert-butylcyclohexyl) ethyl carbonate.
Molecular Properties
| Compound Name | (1-tert-butylcyclohexyl) ethyl carbonate |
| PubChem CID | 58430320 |
| Molecular Formula | C13H24O3 |
| Molecular Weight | 228.33 g/mol |
| Exact Mass | 228.17 |
| IUPAC Name | (1-tert-butylcyclohexyl) ethyl carbonate |
| SMILES | CCOC(=O)OC1(C(C)(C)C)CCCCC1 |
| InChI | InChI=1S/C13H24O3/c1-5-15-11(14)16-13(12(2,3)4)9-7-6-8-10-13/h5-10H2,1-4H3 |
| InChIKey | IRUXWAUNQLPIJN-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 228.33 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (1-tert-butylcyclohexyl) ethyl carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1-tert-butylcyclohexyl) ethyl carbonate?
The IUPAC name of (1-tert-butylcyclohexyl) ethyl carbonate (CID 58430320) is (1-tert-butylcyclohexyl) ethyl carbonate.
What is the SMILES notation for (1-tert-butylcyclohexyl) ethyl carbonate?
The canonical SMILES for (1-tert-butylcyclohexyl) ethyl carbonate is CCOC(=O)OC1(C(C)(C)C)CCCCC1.
What is the InChIKey of (1-tert-butylcyclohexyl) ethyl carbonate?
The InChIKey is IRUXWAUNQLPIJN-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H24O3/c1-5-15-11(14)16-13(12(2,3)4)9-7-6-8-10-13/h5-10H2,1-4H3.
What are the key properties of (1-tert-butylcyclohexyl) ethyl carbonate?
(1-tert-butylcyclohexyl) ethyl carbonate has a molecular weight of 228.33 g/mol, XLogP of 3.91, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (1-tert-butylcyclohexyl) ethyl carbonate is sourced from PubChem (CID 58430320), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).