About 3-[5-(4-piperidin-1-ylpiperidin-1-yl)-1,3,4-thiadiazol-2-yl]phenol
3-[5-(4-piperidin-1-ylpiperidin-1-yl)-1,3,4-thiadiazol-2-yl]phenol (PubChem CID 58430756) has the molecular formula C18H24N4OS
and a molecular weight of 344.48 g/mol. Its IUPAC name is 3-[5-(4-piperidin-1-ylpiperidin-1-yl)-1,3,4-thiadiazol-2-yl]phenol.
Molecular Properties
| Compound Name | 3-[5-(4-piperidin-1-ylpiperidin-1-yl)-1,3,4-thiadiazol-2-yl]phenol |
| PubChem CID | 58430756 |
| Molecular Formula | C18H24N4OS |
| Molecular Weight | 344.48 g/mol |
| Exact Mass | 344.17 |
| IUPAC Name | 3-[5-(4-piperidin-1-ylpiperidin-1-yl)-1,3,4-thiadiazol-2-yl]phenol |
| SMILES | Oc1cccc(-c2nnc(N3CCC(N4CCCCC4)CC3)s2)c1 |
| InChI | InChI=1S/C18H24N4OS/c23-16-6-4-5-14(13-16)17-19-20-18(24-17)22-11-7-15(8-12-22)21-9-2-1-3-10-21/h4-6,13,15,23H,1-3,7-12H2 |
| InChIKey | LDSYPNABKAEXTL-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 344.48 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 3-[5-(4-piperidin-1-ylpiperidin-1-yl)-1,3,4-thiadiazol-2-yl]phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[5-(4-piperidin-1-ylpiperidin-1-yl)-1,3,4-thiadiazol-2-yl]phenol?
The IUPAC name of 3-[5-(4-piperidin-1-ylpiperidin-1-yl)-1,3,4-thiadiazol-2-yl]phenol (CID 58430756) is 3-[5-(4-piperidin-1-ylpiperidin-1-yl)-1,3,4-thiadiazol-2-yl]phenol.
What is the SMILES notation for 3-[5-(4-piperidin-1-ylpiperidin-1-yl)-1,3,4-thiadiazol-2-yl]phenol?
The canonical SMILES for 3-[5-(4-piperidin-1-ylpiperidin-1-yl)-1,3,4-thiadiazol-2-yl]phenol is Oc1cccc(-c2nnc(N3CCC(N4CCCCC4)CC3)s2)c1.
What is the InChIKey of 3-[5-(4-piperidin-1-ylpiperidin-1-yl)-1,3,4-thiadiazol-2-yl]phenol?
The InChIKey is LDSYPNABKAEXTL-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H24N4OS/c23-16-6-4-5-14(13-16)17-19-20-18(24-17)22-11-7-15(8-12-22)21-9-2-1-3-10-21/h4-6,13,15,23H,1-3,7-12H2.
What are the key properties of 3-[5-(4-piperidin-1-ylpiperidin-1-yl)-1,3,4-thiadiazol-2-yl]phenol?
3-[5-(4-piperidin-1-ylpiperidin-1-yl)-1,3,4-thiadiazol-2-yl]phenol has a molecular weight of 344.48 g/mol, XLogP of 3.37, 3 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[5-(4-piperidin-1-ylpiperidin-1-yl)-1,3,4-thiadiazol-2-yl]phenol is sourced from PubChem (CID 58430756), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).