About 2-(1-aminocyclopropyl)-1,3-oxazole-4-carboxamide
2-(1-aminocyclopropyl)-1,3-oxazole-4-carboxamide (PubChem CID 58431201) has the molecular formula C7H9N3O2
and a molecular weight of 167.17 g/mol. Its IUPAC name is 2-(1-aminocyclopropyl)-1,3-oxazole-4-carboxamide.
Molecular Properties
| Compound Name | 2-(1-aminocyclopropyl)-1,3-oxazole-4-carboxamide |
| PubChem CID | 58431201 |
| Molecular Formula | C7H9N3O2 |
| Molecular Weight | 167.17 g/mol |
| Exact Mass | 167.07 |
| IUPAC Name | 2-(1-aminocyclopropyl)-1,3-oxazole-4-carboxamide |
| SMILES | NC(=O)c1coc(C2(N)CC2)n1 |
| InChI | InChI=1S/C7H9N3O2/c8-5(11)4-3-12-6(10-4)7(9)1-2-7/h3H,1-2,9H2,(H2,8,11) |
| InChIKey | IQHKWHWKZHMDJD-UHFFFAOYSA-N |
| XLogP | -0.28 |
| TPSA | 95.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 167.17 |
| LogP ≤ 5 | -0.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-(1-aminocyclopropyl)-1,3-oxazole-4-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(1-aminocyclopropyl)-1,3-oxazole-4-carboxamide?
The IUPAC name of 2-(1-aminocyclopropyl)-1,3-oxazole-4-carboxamide (CID 58431201) is 2-(1-aminocyclopropyl)-1,3-oxazole-4-carboxamide.
What is the SMILES notation for 2-(1-aminocyclopropyl)-1,3-oxazole-4-carboxamide?
The canonical SMILES for 2-(1-aminocyclopropyl)-1,3-oxazole-4-carboxamide is NC(=O)c1coc(C2(N)CC2)n1.
What is the InChIKey of 2-(1-aminocyclopropyl)-1,3-oxazole-4-carboxamide?
The InChIKey is IQHKWHWKZHMDJD-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H9N3O2/c8-5(11)4-3-12-6(10-4)7(9)1-2-7/h3H,1-2,9H2,(H2,8,11).
What are the key properties of 2-(1-aminocyclopropyl)-1,3-oxazole-4-carboxamide?
2-(1-aminocyclopropyl)-1,3-oxazole-4-carboxamide has a molecular weight of 167.17 g/mol, XLogP of -0.28, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1-aminocyclopropyl)-1,3-oxazole-4-carboxamide is sourced from PubChem (CID 58431201), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).