C31H43N9O3Si — CID 58431288
tert-butyl 4-cyano-4-[3-(cyanomethyl)-3-[4-[7-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-d]pyrimidin-4-yl]pyrazol-1-yl]azetidin-1-yl]piperidine-1-carboxylate (PubChem CID 58431288) has the molecular formula C31H43N9O3Si and a molecular weight of 617.83 g/mol. Its IUPAC name is tert-butyl 4-cyano-4-[3-(cyanomethyl)-3-[4-[7-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-d]pyrimidin-4-yl]pyrazol-1-yl]azetidin-1-yl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-cyano-4-[3-(cyanomethyl)-3-[4-[7-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-d]pyrimidin-4-yl]pyrazol-1-yl]azetidin-1-yl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 58431288 |
| Molecular Formula | C31H43N9O3Si |
| Molecular Weight | 617.83 g/mol |
| Exact Mass | 617.33 |
| IUPAC Name | tert-butyl 4-cyano-4-[3-(cyanomethyl)-3-[4-[7-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-d]pyrimidin-4-yl]pyrazol-1-yl]azetidin-1-yl]piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(C#N)(N2CC(CC#N)(n3cc(-c4ncnc5c4ccn5COCC[Si](C)(C)C)cn3)C2)CC1 |
| InChI | InChI=1S/C31H43N9O3Si/c1-29(2,3)43-28(41)37-13-9-30(19-33,10-14-37)39-20-31(21-39,8-11-32)40-18-24(17-36-40)26-25-7-12-38(27(25)35-22-34-26)23-42-15-16-44(4,5)6/h7,12,17-18,22H,8-10,13-16,20-21,23H2,1-6H3 |
| InChIKey | WANZUOUKLVUUSR-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 138.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 617.83 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|