C30H44N8O3Si — CID 58431327
tert-butyl 4-[3-(cyanomethyl)-3-[4-[7-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-d]pyrimidin-4-yl]pyrazol-1-yl]azetidin-1-yl]piperidine-1-carboxylate (PubChem CID 58431327) has the molecular formula C30H44N8O3Si and a molecular weight of 592.82 g/mol. Its IUPAC name is tert-butyl 4-[3-(cyanomethyl)-3-[4-[7-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-d]pyrimidin-4-yl]pyrazol-1-yl]azetidin-1-yl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[3-(cyanomethyl)-3-[4-[7-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-d]pyrimidin-4-yl]pyrazol-1-yl]azetidin-1-yl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 58431327 |
| Molecular Formula | C30H44N8O3Si |
| Molecular Weight | 592.82 g/mol |
| Exact Mass | 592.33 |
| IUPAC Name | tert-butyl 4-[3-(cyanomethyl)-3-[4-[7-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-d]pyrimidin-4-yl]pyrazol-1-yl]azetidin-1-yl]piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(N2CC(CC#N)(n3cc(-c4ncnc5c4ccn5COCC[Si](C)(C)C)cn3)C2)CC1 |
| InChI | InChI=1S/C30H44N8O3Si/c1-29(2,3)41-28(39)35-12-7-24(8-13-35)37-19-30(20-37,10-11-31)38-18-23(17-34-38)26-25-9-14-36(27(25)33-21-32-26)22-40-15-16-42(4,5)6/h9,14,17-18,21,24H,7-8,10,12-13,15-16,19-20,22H2,1-6H3 |
| InChIKey | RULGOXDRRSGTIJ-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 114.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.82 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|