C31H46N8O3Si — CID 58431386
tert-butyl 4-[3-(cyanomethyl)-3-[4-[7-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-d]pyrimidin-4-yl]pyrazol-1-yl]azetidin-1-yl]-2-methylpiperidine-1-carboxylate (PubChem CID 58431386) has the molecular formula C31H46N8O3Si and a molecular weight of 606.85 g/mol. Its IUPAC name is tert-butyl 4-[3-(cyanomethyl)-3-[4-[7-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-d]pyrimidin-4-yl]pyrazol-1-yl]azetidin-1-yl]-2-methylpiperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[3-(cyanomethyl)-3-[4-[7-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-d]pyrimidin-4-yl]pyrazol-1-yl]azetidin-1-yl]-2-methylpiperidine-1-carboxylate |
|---|---|
| PubChem CID | 58431386 |
| Molecular Formula | C31H46N8O3Si |
| Molecular Weight | 606.85 g/mol |
| Exact Mass | 606.35 |
| IUPAC Name | tert-butyl 4-[3-(cyanomethyl)-3-[4-[7-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-d]pyrimidin-4-yl]pyrazol-1-yl]azetidin-1-yl]-2-methylpiperidine-1-carboxylate |
| SMILES | CC1CC(N2CC(CC#N)(n3cc(-c4ncnc5c4ccn5COCC[Si](C)(C)C)cn3)C2)CCN1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C31H46N8O3Si/c1-23-16-25(8-13-38(23)29(40)42-30(2,3)4)37-19-31(20-37,10-11-32)39-18-24(17-35-39)27-26-9-12-36(28(26)34-21-33-27)22-41-14-15-43(5,6)7/h9,12,17-18,21,23,25H,8,10,13-16,19-20,22H2,1-7H3 |
| InChIKey | ZMPBSGNZJBFLML-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 114.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 606.85 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|