C25H35FN8OSi — CID 58431407
2-[1-[(3S,4R)-3-fluoropiperidin-4-yl]-3-[4-[7-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-d]pyrimidin-4-yl]pyrazol-1-yl]azetidin-3-yl]acetonitrile (PubChem CID 58431407) has the molecular formula C25H35FN8OSi and a molecular weight of 510.69 g/mol. Its IUPAC name is 2-[1-[(3S,4R)-3-fluoropiperidin-4-yl]-3-[4-[7-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-d]pyrimidin-4-yl]pyrazol-1-yl]azetidin-3-yl]acetonitrile.
| Compound Name | 2-[1-[(3S,4R)-3-fluoropiperidin-4-yl]-3-[4-[7-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-d]pyrimidin-4-yl]pyrazol-1-yl]azetidin-3-yl]acetonitrile |
|---|---|
| PubChem CID | 58431407 |
| Molecular Formula | C25H35FN8OSi |
| Molecular Weight | 510.69 g/mol |
| Exact Mass | 510.27 |
| IUPAC Name | 2-[1-[(3S,4R)-3-fluoropiperidin-4-yl]-3-[4-[7-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-d]pyrimidin-4-yl]pyrazol-1-yl]azetidin-3-yl]acetonitrile |
| SMILES | C[Si](C)(C)CCOCn1ccc2c(-c3cnn(C4(CC#N)CN([C@@H]5CCNC[C@@H]5F)C4)c3)ncnc21 |
| InChI | InChI=1S/C25H35FN8OSi/c1-36(2,3)11-10-35-18-32-9-5-20-23(29-17-30-24(20)32)19-12-31-34(14-19)25(6-7-27)15-33(16-25)22-4-8-28-13-21(22)26/h5,9,12,14,17,21-22,28H,4,6,8,10-11,13,15-16,18H2,1-3H3/t21-,22+/m0/s1 |
| InChIKey | QNXHZKXARHIBAR-FCHUYYIVSA-N |
| XLogP | 3.23 |
| TPSA | 96.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.69 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|