C32H40BFN8O4Si — CID 58431411
[4-[4-[3-(cyanomethyl)-3-[4-[7-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-d]pyrimidin-4-yl]pyrazol-1-yl]azetidin-1-yl]piperidine-1-carbonyl]-2-fluorophenyl]boronic acid (PubChem CID 58431411) has the molecular formula C32H40BFN8O4Si and a molecular weight of 658.62 g/mol. Its IUPAC name is [4-[4-[3-(cyanomethyl)-3-[4-[7-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-d]pyrimidin-4-yl]pyrazol-1-yl]azetidin-1-yl]piperidine-1-carbonyl]-2-fluorophenyl]boronic acid.
| Compound Name | [4-[4-[3-(cyanomethyl)-3-[4-[7-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-d]pyrimidin-4-yl]pyrazol-1-yl]azetidin-1-yl]piperidine-1-carbonyl]-2-fluorophenyl]boronic acid |
|---|---|
| PubChem CID | 58431411 |
| Molecular Formula | C32H40BFN8O4Si |
| Molecular Weight | 658.62 g/mol |
| Exact Mass | 658.30 |
| IUPAC Name | [4-[4-[3-(cyanomethyl)-3-[4-[7-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-d]pyrimidin-4-yl]pyrazol-1-yl]azetidin-1-yl]piperidine-1-carbonyl]-2-fluorophenyl]boronic acid |
| SMILES | C[Si](C)(C)CCOCn1ccc2c(-c3cnn(C4(CC#N)CN(C5CCN(C(=O)c6ccc(B(O)O)c(F)c6)CC5)C4)c3)ncnc21 |
| InChI | InChI=1S/C32H40BFN8O4Si/c1-47(2,3)15-14-46-22-40-13-8-26-29(36-21-37-30(26)40)24-17-38-42(18-24)32(9-10-35)19-41(20-32)25-6-11-39(12-7-25)31(43)23-4-5-27(33(44)45)28(34)16-23/h4-5,8,13,16-18,21,25,44-45H,6-7,9,11-12,14-15,19-20,22H2,1-3H3 |
| InChIKey | FDTSDIIYPFVLFD-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 145.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 658.62 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|