About 1,5-dimethyl-3-[(1S)-1-phenylethyl]pyrrolo[2,3-b]pyridine
1,5-dimethyl-3-[(1S)-1-phenylethyl]pyrrolo[2,3-b]pyridine (PubChem CID 58431450) has the molecular formula C17H18N2
and a molecular weight of 250.34 g/mol. Its IUPAC name is 1,5-dimethyl-3-[(1S)-1-phenylethyl]pyrrolo[2,3-b]pyridine.
Molecular Properties
| Compound Name | 1,5-dimethyl-3-[(1S)-1-phenylethyl]pyrrolo[2,3-b]pyridine |
| PubChem CID | 58431450 |
| Molecular Formula | C17H18N2 |
| Molecular Weight | 250.34 g/mol |
| Exact Mass | 250.15 |
| IUPAC Name | 1,5-dimethyl-3-[(1S)-1-phenylethyl]pyrrolo[2,3-b]pyridine |
| SMILES | Cc1cnc2c(c1)c([C@@H](C)c1ccccc1)cn2C |
| InChI | InChI=1S/C17H18N2/c1-12-9-15-16(11-19(3)17(15)18-10-12)13(2)14-7-5-4-6-8-14/h4-11,13H,1-3H3/t13-/m0/s1 |
| InChIKey | PVUQYJCRRXGRHR-ZDUSSCGKSA-N |
| XLogP | 4.03 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 250.34 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1,5-dimethyl-3-[(1S)-1-phenylethyl]pyrrolo[2,3-b]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,5-dimethyl-3-[(1S)-1-phenylethyl]pyrrolo[2,3-b]pyridine?
The IUPAC name of 1,5-dimethyl-3-[(1S)-1-phenylethyl]pyrrolo[2,3-b]pyridine (CID 58431450) is 1,5-dimethyl-3-[(1S)-1-phenylethyl]pyrrolo[2,3-b]pyridine.
What is the SMILES notation for 1,5-dimethyl-3-[(1S)-1-phenylethyl]pyrrolo[2,3-b]pyridine?
The canonical SMILES for 1,5-dimethyl-3-[(1S)-1-phenylethyl]pyrrolo[2,3-b]pyridine is Cc1cnc2c(c1)c([C@@H](C)c1ccccc1)cn2C.
What is the InChIKey of 1,5-dimethyl-3-[(1S)-1-phenylethyl]pyrrolo[2,3-b]pyridine?
The InChIKey is PVUQYJCRRXGRHR-ZDUSSCGKSA-N. The full InChI is InChI=1S/C17H18N2/c1-12-9-15-16(11-19(3)17(15)18-10-12)13(2)14-7-5-4-6-8-14/h4-11,13H,1-3H3/t13-/m0/s1.
What are the key properties of 1,5-dimethyl-3-[(1S)-1-phenylethyl]pyrrolo[2,3-b]pyridine?
1,5-dimethyl-3-[(1S)-1-phenylethyl]pyrrolo[2,3-b]pyridine has a molecular weight of 250.34 g/mol, XLogP of 4.03, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1,5-dimethyl-3-[(1S)-1-phenylethyl]pyrrolo[2,3-b]pyridine is sourced from PubChem (CID 58431450), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).