C31H31N3O3 — CID 58431579
2-[6-(1,4-dioxa-8-azaspiro[4.5]decan-8-yl)-3-pyridinyl]-1-(2-methyl-1,5-diphenylpyrrol-3-yl)ethanone (PubChem CID 58431579) has the molecular formula C31H31N3O3 and a molecular weight of 493.61 g/mol. Its IUPAC name is 2-[6-(1,4-dioxa-8-azaspiro[4.5]decan-8-yl)-3-pyridinyl]-1-(2-methyl-1,5-diphenylpyrrol-3-yl)ethanone.
| Compound Name | 2-[6-(1,4-dioxa-8-azaspiro[4.5]decan-8-yl)-3-pyridinyl]-1-(2-methyl-1,5-diphenylpyrrol-3-yl)ethanone |
|---|---|
| PubChem CID | 58431579 |
| Molecular Formula | C31H31N3O3 |
| Molecular Weight | 493.61 g/mol |
| Exact Mass | 493.24 |
| IUPAC Name | 2-[6-(1,4-dioxa-8-azaspiro[4.5]decan-8-yl)-3-pyridinyl]-1-(2-methyl-1,5-diphenylpyrrol-3-yl)ethanone |
| SMILES | Cc1c(C(=O)Cc2ccc(N3CCC4(CC3)OCCO4)nc2)cc(-c2ccccc2)n1-c1ccccc1 |
| InChI | InChI=1S/C31H31N3O3/c1-23-27(21-28(25-8-4-2-5-9-25)34(23)26-10-6-3-7-11-26)29(35)20-24-12-13-30(32-22-24)33-16-14-31(15-17-33)36-18-19-37-31/h2-13,21-22H,14-20H2,1H3 |
| InChIKey | FASJMOBRNAZWOY-UHFFFAOYSA-N |
| XLogP | 5.62 |
| TPSA | 56.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.61 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'pyrrole_B(29)', 'substructure': 'N/A'} |
|---|